deoxyguanosine

{{Chembox

| Reference = {{cite web |url=https://pubchem.ncbi.nlm.nih.gov/compound/2_-deoxyguanosine#section=Top |title=2'-deoxyguanosine |date=24 December 2016 |publisher=National Center for Biotechnology Information |work=PubChem Compound Database |access-date=2 January 2017 |archive-url=https://web.archive.org/web/20170102160635/https://pubchem.ncbi.nlm.nih.gov/compound/2_-deoxyguanosine#section=Top |archive-date=2 January 2017 |url-status=live }}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 396326178

| ImageFile=Desoxyguanosin.svg

| ImageSize=170

| ImageAlt = Skeletal formula of deoxyadenosine

| ImageFile1 = Deoxyadenosine-3D-balls.png

| ImageAlt1 = Ball-and-stick model of the deoxyadenosine molecule

| IUPACName=2-Amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 163230

| InChI = 1/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1

| InChIKey = YKBGVTZYEHREMT-KVQBGUIXBI

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YKBGVTZYEHREMT-KVQBGUIXSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=961-07-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G9481N71RO

| PubChem=638

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 68908

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 17172

| SMILES = c1nc2c(n1[C@H]3C[C@@H]([C@H](O3)CO)O)[nH]c(nc2=O)N

| MeSHName=Deoxyguanosine

}}

|Section2={{Chembox Properties

| C=10 | H=13 | N=5 | O=4

| Appearance=

| Density=

| MeltingPtC=250

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deoxyguanosine is composed of the purine nucleobase guanine linked by its N9 nitrogen to the C1 carbon of deoxyribose. It is similar to guanosine, but with one hydroxyl group removed from the 2' position of the ribose sugar (making it deoxyribose). If a phosphate group is attached at the 5' position, it becomes deoxyguanosine monophosphate.

Deoxyguanosine is one of the four deoxyribonucleosides that make up DNA.{{cite web | url = http://www.hmdb.ca/metabolites/HMDB0000085 | title = Human Metabolome Database (HMDB) metabocard for Deoxyguanosine (HMDB0000085) }}