deoxyguanosine monophosphate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447289738

| ImageFile=Desoxyguanosinmonophosphat protoniert.svg

| ImageAlt = Skeletal formula of deoxyguanosine monophosphate

| ImageFile1 = Deoxyguanosine-monophosphate-anion-3D-spacefill.png

| ImageSize1=180

| ImageAlt1 = Space-filling model of the deoxyguanosine monophosphate anion

| IUPACName=2′-Deoxyguanylic acid

| SystematicName=[(2R,3S,5R)-5-(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate

| OtherNames=

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 5122

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=902-04-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7EAM4TG712

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 16192

| PubChem = 65059

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 58570

| SMILES = C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(N=C3O)N)COP(=O)(O)O)O

| InChI = 1/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1

| InChIKey = LTFMZDNNPPEQNG-KVQBGUIXBV

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = LTFMZDNNPPEQNG-KVQBGUIXSA-N

}}

|Section2={{Chembox Properties

| Formula=C₁₀H₁₄N₅O₇P

| MolarMass=347.2243

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deoxyguanosine monophosphate (dGMP), also known as deoxyguanylic acid or deoxyguanylate in its conjugate acid and conjugate base forms, respectively, is a derivative of the common nucleotide guanosine triphosphate (GTP), in which the –OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose has been reduced to just a hydrogen atom (hence the "deoxy-" part of the name). It is used as a monomer in DNA.{{Cite book

| publisher = John Wiley & Sons

| isbn = 9783527622535

| last = Müller

| first = Sabine

| title = Nucleic Acids from A to Z

| date = 2008-09-08

| url = https://books.google.com/books?id=x3hxZIhP6ScC&q=Deoxyguanosine+monophosphate&pg=PA62

}}