dibenzazepine

{{Chembox

| ImageFile = Dibenzazepine.svg

| ImageAlt = Skeletal formula of dibenzazepine

| ImageFile1 = Dibenzazepine-3D-balls.png

| ImageSize1 = 220

| ImageAlt1 = Ball-and-stick model of the dibenzazepine molecule

| PIN = 5H-Dibenzo[b,f]azepine

| OtherNames = Iminostilbene

|Section1={{Chembox Identifiers

| CASNo = 256-96-2

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII = J411KQJ8C2

| UNII_Ref = {{fdacite|correct|FDA}}

| PubChem = 9212

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 47802

| ChEMBL = 243596

| ChemSpiderID = 8857

| SMILES = c3cc2c(\C=C/c1c(cccc1)N2)cc3

| InChI = InChI=1S/C14H11N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10,15H

}}

|Section2={{Chembox Properties

| C=14 | H=11 | N=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Dibenzazepine (iminostilbene) is a chemical compound with two benzene rings fused to an azepine ring.{{Cite book|title=Pharmacology and therapeutics for dentistry|last=Yagiela|first=John|last2=Dowd|first2=Frank|last3=Johnson|first3=Bart|last4=Mariotti|first4=Angelo|last5=Neidle|first5=Enid|date=2011|publisher=Mosby Elsevier|isbn=9780323078245|edition=6th|location=St. Louis, Mo.|pages=175|oclc=769189434}} Many pharmaceuticals, such as carbamazepine, oxcarbazepine, and depramine, are based on a dibenzazepine structure.