difenamizole

{{Chembox

| ImageFile = Difenamizole.svg

| ImageClass = skin-invert-image

| ImageSize = 200px

| ImageAlt =

| IUPACName = 2-(Dimethylamino)-N-(2,5-diphenylpyrazol-3-yl)propanamide

| OtherNames = Diphenamizole

|Section1={{Chembox Identifiers

| CASNo = 20170-20-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 24MR6YLL3W

| PubChem = 65695

| ChemSpiderID = 59123

| ChEMBL = 2105587

| InChI=1S/C20H22N4O/c1-15(23(2)3)20(25)21-19-14-18(16-10-6-4-7-11-16)22-24(19)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,21,25)

| InChIKey= PCXMKBOWWVXEDT-UHFFFAOYSA-N

| SMILES = CC(C(=O)NC1=CC(=NN1C2=CC=CC=C2)C3=CC=CC=C3)N(C)C}}

|Section2={{Chembox Properties

| C=20 | H=22 | N=4 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Difenamizole (INN; brand name Pasalin; former developmental code name AP-14) is a nonsteroidal anti-inflammatory drug (NSAID) and analgesic of the pyrazolone group related to metamizole.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA398|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=398–}} It has monoaminergic properties, including inhibition of monoamine oxidase, augmentation of pargyline-induced elevation of striatal dopamine levels, inhibition of K⁺-induced striatal dopamine release, and inhibition of the reuptake of dopamine.{{cite journal|last1=Secci|first1=D.|last2=Bolasco|first2=A.|last3=Chimenti|first3=P.|last4=Carradori|first4=S.|title=The State of the Art of Pyrazole Derivatives as Monoamine Oxidase Inhibitors and Antidepressant/Anticonvulsant Agents|journal=Current Medicinal Chemistry|volume=18|issue=33|year=2011|pages=5114–5144|issn=0929-8673|doi=10.2174/092986711797636090|pmid=22050759}}{{cite journal | vauthors = Kameyama T, Nabeshima T, Yoshida N, Yamaguchi K | title = Neurochemical studies of an analgesic, 1,3-diphenyl-5-(2-dimethylaminopropionamide)-pyrazole [difenamizole] | journal = Res. Commun. Chem. Pathol. Pharmacol. | volume = 31 | issue = 1 | pages = 31–53 | year = 1981 | pmid = 6454942 }}{{cite journal|last1=NABESHIMA|first1=Toshitaka|last2=YAMAGUCHI|first2=Kazumasa|last3=KAMEYAMA|first3=Tsutomu|title=Effects of Difenamizole on Content of Catecholamines and Metabolites in Mouse Brain|journal=The Japanese Journal of Pharmacology|volume=28|issue=4|year=1978|pages=642–646|issn=0021-5198|doi=10.1254/jjp.28.642|pmid=732046|doi-access=free}}