dinotefuran

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443695346

| ImageFile = Dinotefuran.svg

| IUPACName = 2-methyl-1-nitro-3-[(tetrahydro-3-furanyl) methyl] guanidine

| OtherNames = (RS)-1-methyl-2-nitro-3-[(tetrahydro-3-furanyl) methyl] guanidine; MTI-446

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 165252-70-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1W509710WF

| PubChem = 197701

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 171124

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 39183

| SMILES = [O-][N+](=O)NC(=N/C)\NCC1CCOC1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YKBZOVFACRVRJN-UHFFFAOYSA-N

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18509

}}

|Section2={{Chembox Properties

| Properties_ref = [http://www.mitsuichemicals.com/dinotefuran.htm Dinotefuran], Mitsui Chemicals

| C=7 | H=14 | N=4 | O=3

| Appearance =

| Density =

| MeltingPt = 107.5

| BoilingPt =

| Solubility =39.83 g/L

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| LD50 = ≥2000 mg/kg (oral, rat and mouse)

}}

| Section6 = {{Chembox Pharmacology

| Pharmacology_ref =

| ATCCode_prefix =

| ATCCode_suffix =

| ATC_Supplemental =

| ATCvet =

| Licence_EU =

| INN =

| INN_EMA =

| Licence_US =

| Legal_status =

| Legal_AU =

| Legal_AU_comment =

| Legal_CA =

| Legal_CA_comment =

| Legal_NZ =

| Legal_NZ_comment =

| Legal_UK =

| Legal_UK_comment =

| Legal_US =

| Legal_US_comment =

| Legal_EU =

| Legal_EU_comment =

| Legal_UN =

| Legal_UN_comment =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_AU_comment =

| Dependence_liability =

| AdminRoutes =

| Bioavail =

| ProteinBound =

| Metabolism =

| Metabolites =

| OnsetOfAction =

| HalfLife =

| DurationOfAction =

| Excretion =

}}

}}

Dinotefuran is an insecticide of the neonicotinoid class developed by Mitsui Chemicals for control of insect pests such as aphids, whiteflies, thrips, leafhoppers, leafminers, sawflies, mole cricket, white grubs, lacebugs, billbugs, beetles, mealybugs, and cockroaches on leafy vegetables, in residential and commercial buildings, and for professional turf management.[http://nepis.epa.gov/Exe/ZyNET.exe/P100BIDI.TXT?ZyActionD=ZyDocument&Client=EPA&Index=2000+Thru+2005&Docs=&Query=&Time=&EndTime=&SearchMethod=1&TocRestrict=n&Toc=&TocEntry=&QField=&QFieldYear=&QFieldMonth=&QFieldDay=&IntQFieldOp=0&ExtQFieldOp=0&XmlQuery=&File=D%3A\zyfiles\Index%20Data\00thru05\Txt\00000028\P100BIDI.txt&User=ANONYMOUS&Password=anonymous&SortMethod=h|-&MaximumDocuments=1&FuzzyDegree=0&ImageQuality=r75g8/r75g8/x150y150g16/i425&Display=p|f&DefSeekPage=x&SearchBack=ZyActionL&Back=ZyActionS&BackDesc=Results%20page&MaximumPages=1&ZyEntry=1&SeekPage=x&ZyPURL Dinotefuran Pesticide Fact Sheet], United States Environmental Protection Agency Its mechanism of action involves disruption of the insect's nervous system by inhibiting nicotinic acetylcholine receptors.

In July 2013, the US state of Oregon temporarily restricted the use of dinotefuran pending the results of an investigation into a large bee kill. [http://www.pctonline.com/Oregon-Dinotefuran-restrictions.aspx "Oregon Restricts Use of Certain Dinotefuran Pesticides", Pest Control Technology, 2 July 2013]

Dinotefuran is also used in veterinary medicine as a flea and tick preventive for dogs and as a flea preventive for cats. It is used in combination with pyriproxifen and/or permethrin.{{cite web | website=European Medicines Agency | title=Vectra Felis | date=6 June 2014 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/vectra-felis | access-date=15 June 2024}}{{cite web | title=Vectra 3D EPAR | website=European Medicines Agency | date=26 March 2014 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/vectra-3d | access-date=15 June 2024}}