fletazepam

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 450847004

| IUPAC_name = 7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodiazepine

| image = Fletazepam.svg

| width = 200

| tradename =

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 34482-99-0

| ATC_prefix = none

| PubChem = 36834

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 33806

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3AH8OSQ79O

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04191

| C=17 | H=13 | Cl=1 | F=4 | N=2

| smiles = FC1=CC=CC=C1C2=NCCN(CC(F)(F)F)C3=C2C=C(Cl)C=C3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H13ClF4N2/c18-11-5-6-15-13(9-11)16(12-3-1-2-4-14(12)19)23-7-8-24(15)10-17(20,21)22/h1-6,9H,7-8,10H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CIZCSUNUBQXVFP-UHFFFAOYSA-N

}}

Fletazepam{{Cite patent|country=DE|number=2106175|pubdate=1971-09-30|title=Neue 1-Polyfluoralkylbenzodiazepine und Verfahren zu ihrer Herstellung [Novel 1-polyfluoroalkylbenzodiazepines and processes for their preparation]|assign=Sherico Ltd.|inventor1-last=Steinmann|inventor1-first=Martin }} is a drug which is a benzodiazepine derivative. It has sedative and anxiolytic effects similar to those produced by other benzodiazepine derivatives, but is mainly notable for its strong muscle relaxant properties.{{cite journal | vauthors = Barnett A, Goldstein J, Fiedler EP, Taber RI | title = The pharmacology of fletazepam a centrally-acting muscle relaxant | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 212 | issue = 1 | pages = 164–74 | date = November 1974 | pmid = 4476200 }}

Fletazepam is most closely related to other N-trifluoroethyl substituted benzodiazepines such as halazepam and quazepam.{{cite journal | vauthors = Iorio LC, Barnett A, Billard W | title = Selective affinity of 1-N-trifluoroethyl benzodiazepines for cerebellar type 1 receptor sites | journal = Life Sciences | volume = 35 | issue = 1 | pages = 105–13 | date = July 1984 | pmid = 6738302 | doi = 10.1016/0024-3205(84)90157-7 }}

See also

References