fluminorex

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| verifiedrevid = 449582457

| IUPAC_name = (RS)-5-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-amine

| image = Fluminorex.svg

| image_class = skin-invert-image

| width = 200px

| chirality = Racemic mixture

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 720-76-3

| ATC_prefix = none

| PubChem = 24100

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 22530

| ChEMBL = 2107247

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LUO2Z7954T

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04210

| C=10 | H=9 | F=3 | N=2 | O=1

| smiles = FC(F)(F)c1ccc(cc1)C2O\C(=N/C2)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H9F3N2O/c11-10(12,13)7-3-1-6(2-4-7)8-5-15-9(14)16-8/h1-4,8H,5H2,(H2,14,15)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NMGYDYBWRZHLHR-UHFFFAOYSA-N

}}

Fluminorex is a centrally acting sympathomimetic which is related to other drugs such as aminorex and pemoline. It was developed as an appetite suppressant by McNeil Laboratories in the 1950s.US Patent 3278382 - 2-amino-5-aryloxazoline compositions and methods of using same{{cite journal | vauthors = Maier J, Mayer FP, Brandt SD, Sitte HH | title = DARK Classics in Chemical Neuroscience: Aminorex Analogues | journal = ACS Chemical Neuroscience | volume = 9 | issue = 10 | pages = 2484–2502 | date = October 2018 | doi = 10.1021/acschemneuro.8b00415 | pmid = 30269490 | pmc = 6287711 }}