gastrodin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 423646115

| Name = Gastrodin

| ImageFile = Gastrodin.svg

| ImageSize = 200px

| ImageName = Chemical structure of gastrodin

| ImageAlt = Chemical structure of gastrodin

| IUPACName = 4-(Hydroxymethyl)phenyl β-D-glucopyranoside

| SystematicName = (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-[4-(hydroxymethyl)phenoxy]oxane-3,4,5-triol

| OtherNames = Gastrodine
4-(β-D-glucopyranosyloxy)benzyl alcohol

|Section1={{Chembox Identifiers

| CASNo = 62499-27-8

| CASNo_Ref = {{cascite|correct|??}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5YS9U2W3RQ

| PubChem = 115067

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 102977

| SMILES = O(c1ccc(cc1)CO)[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO

| InChI = 1/C13H18O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1

| InChIKey = PUQSUZTXKPLAPR-UJPOAAIJBX

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H18O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = PUQSUZTXKPLAPR-UJPOAAIJSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=13 | H=18 | O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Gastrodin is a chemical compound which is the glucoside of gastrodigenin. It has been isolated from the rhizomes of two orchid species, Gastrodia elata and Galeola faberi.{{cite journal|pmid=8009989|year=1993|last1=Li|first1=Y. M.|title=Studies on the phenolic derivatives from Galeola faberi Rolfe|journal=Yao Xue Xue Bao = Acta Pharmaceutica Sinica|volume=28|issue=10|pages=766–71|last2=Zhou|first2=Z. L.|last3=Hong|first3=Y. F.}} It can also be produced by biotransformation of 4-hydroxybenzaldehyde by Datura tatula cell cultures.{{Cite journal | last1 = Gong | first1 = J. | last2 = Ma | first2 = W. | last3 = Pu | first3 = J. | last4 = Xu | first4 = S. | last5 = Zheng | first5 = S. | last6 = Xiao | first6 = C. | doi = 10.1016/S1872-2075(06)60056-3 | title = Production of Gastrodin Through Biotransformation of p-hydroxybenzaldehyde Using Cell Suspension Cultures of Datura tatula L | journal = Chinese Journal of Biotechnology | volume = 22 | issue = 5 | pages = 800–804 | year = 2006 | pmid = 17037205}}

G. elata rhizome is a herb used in traditional Chinese medicine to treat headache, and it is standardized in the Chinese Pharmacopoeia by gastrodin and gastrodigenin content.{{cite book |title=中国药典 |volume=1 |date=2020|language=zh |isbn=978-7-5067-7337-9 |url=https://db.ouryao.com/yd2020/view.php?id=f73d551fe4 |page=59 |chapter=天麻 / GASTRODIAE RHIZOMA|author1=国家药典委员会 }} In line with this traditional use, gastrodin and its acetyl derivative are used in China as an over-the-counter drug to treat neurasthenia, headache, and migraine.{{cite web |title=Gastrodin Tablets (天麻素片) Monograph |url=http://drugs.dxy.cn/drug/128981.htm |website=drugs.dxy.cn}} It is available as a dietary supplement in other countries.

A Chinese literature review considers it useful for a range of central nervous system disorders, with the evidence coming from mostly Chinese researches.{{cite journal |last1=Liu |first1=Y |last2=Gao |first2=J |last3=Peng |first3=M |last4=Meng |first4=H |last5=Ma |first5=H |last6=Cai |first6=P |last7=Xu |first7=Y |last8=Zhao |first8=Q |last9=Si |first9=G |title=A Review on Central Nervous System Effects of Gastrodin. |journal=Frontiers in Pharmacology |date=2018 |volume=9 |pages=24 |doi=10.3389/fphar.2018.00024 |pmid=29456504 |pmc=5801292|doi-access=free }}