girisopam

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447996741

| IUPAC_name = 1-(3-chlorophenyl)-7,8-dimethoxy-4-methyl-5H-2,3-benzodiazepine

| image = Girisopam.svg

| width = 200

| tradename =

| legal_status =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 82230-53-3

| ATC_prefix = none

| PubChem = 71257

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1915065

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64387

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2LP301A921

| C=18 | H=17 | Cl=1 | N=2 | O=2

| smiles = Clc3cccc(C\2=N\N=C(/Cc1c/2cc(OC)c(OC)c1)C)c3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H17ClN2O2/c1-11-7-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-5-4-6-14(19)8-12/h4-6,8-10H,7H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VQYLGVVODFDFNK-UHFFFAOYSA-N

}}

Girisopam{{cite patent | country = US | number = 4322346 | title = 5H-2,3-Benzodiazepine derivatives | gdate = 30 March 1982 | inventor = Korosi J, Lang T, Szekely J, Andrasi F, Zolyomi G, Borsi J, Katali G, Hamori T, Gabriella S, Zsuz MN, Miglecz E }} (GYKI-51189, EGIS-5810) is a drug which is a 2,3-benzodiazepine derivative, related to tofisopam and zometapine. It has selective anxiolytic action with no sedative, anticonvulsant or muscle relaxant effects.{{cite journal | vauthors = Andrási F, Horváth K, Sineger E, Berzsenyi P, Borsy J, Kenessey A, Tarr M, Láng T, Kórösi J, Hámori T | title = Neuropharmacology of a new psychotropic 2,3-benzodiazepine | journal = Arzneimittel-Forschung | volume = 37 | issue = 10 | pages = 1119–24 | date = October 1987 | pmid = 2893623 }}{{cite journal | vauthors = Horváth K, Andrási F, Botka P, Hámori T | title = Anxiolytic profile of girisopam and GYKI 52,322 (EGIS 6775). Comparison with chlordiazepoxide and buspirone | journal = Acta Physiologica Hungarica | volume = 79 | issue = 2 | pages = 153–61 | date = 1992 | pmid = 1363928 }}{{cite journal | vauthors = Horváth EJ, Salamon C, Bakonyi A, Fekete MI, Palkovits M | title = [(3)H]-girisopam, a novel selective benzodiazepine for the 2, 3-benzodiazepine binding site | journal = Brain Research. Brain Research Protocols | volume = 4 | issue = 2 | pages = 230–5 | date = July 1999 | pmid = 10446419 | doi = 10.1016/s1385-299x(99)00025-2 }}

See also

References

{{Reflist|2}}

{{Anxiolytics}}

{{Benzodiazepines}}

Category:Benzodiazepines

Category:3-Chlorophenyl compounds

Category:Phenol ethers

{{Anxiolytic-stub}}