heterocodeine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461087666
| IUPAC_name = (5α,6α)-6-Methoxy-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3-ol
| image = Heterocodeine.svg
| alt = Skeletal formula
| width = 210
| image2 = Heterocodeine molecule ball.png
| alt2 = Ball-and-stick model
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US = Schedule II
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 639-47-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = SBO5K94K8L
| ATC_prefix = none
| ATC_suffix =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 358043
| PubChem = 5462505
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4575432
| C=18 | H=21 | N=1 | O=3
| smiles = O(C)[C@H]2\C=C/[C@H]5[C@@H]4N(CC[C@@]51c3c(O[C@H]12)c(O)ccc3C4)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H21NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,11-12,14,17,20H,7-9H2,1-2H3/t11-,12+,14-,17-,18-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FNAHUZTWOVOCTL-XSSYPUMDSA-N
| synonyms = Heterocodeine, Morphine 6-methyl ether
}}
Heterocodeine (6-methoxymorphine) is an opiate derivative, the 6-methyl ether of morphine, and a structural isomer of codeine; it is called "hetero-" because it is the reverse isomer of codeine. Heterocodeine was first synthesised in 1932 and first patented in 1935.{{cite patent | country = US | number = 2058521 }} It can be made from morphine by selective methylation.{{cite journal | vauthors = Barber RB, Rapoport H | title = Synthesis of thebaine and oripavine from codeine and morphine | journal = Journal of Medicinal Chemistry | volume = 18 | issue = 11 | pages = 1074–7 | date = November 1975 | pmid = 1177252 | doi = 10.1021/jm00245a006 }} Codeine is the natural mono-methyl ether, but must be metabolized for activity (that is, it is a prodrug). In contrast the semi-synthetic mono-methyl ether, heterocodeine is a direct agonist. The 6,7,8,14 tetradehydro 3,6 methyl di-ether of morphine is thebaine.
Heterocodeine is 6 times more potent than morphine{{cite web | title = Chemistry of Opioid Analgesics | work = PHA 5155- Neurology Pharmacotherapeutics Medicinal Chemistry Tutorials | vauthors = Woster PM | url = http://www.acsmedchem.org/module/opioid.html | archive-url = https://web.archive.org/web/20070716115228/http://www.acsmedchem.org/module/opioid.html | archive-date=2007-07-16 }} due to having a substitution at the 6-hydroxy position, in a similar manner to 6-acetylmorphine.{{cite web | url = http://www.pharmacy.umaryland.edu/faculty/acoop/decfolder/DEC2000.pdf | title = Biological evaluation of compounds for their physical dependence potential & abuse liability. XXIV. | work = Drug evaluation committee of the college on problems of drug dependence | date = 2000 | vauthors = Coop A, Jacobson AE }} The drug methyldihydromorphine (dihydroheterocodeine) is a derivative of heterocodeine. Like the morphine metabolite morphine-6-glucuronide, 6-position branches (esters or ethers) of morphine bind to the otherwise unagonized human mu receptor subtype mu-3 (or μ3); as well as the 6-acetylmorphine metabolite of heroin this includes heterocodeine.{{cite journal | vauthors = Brown GP, Yang K, King MA, Rossi GC, Leventhal L, Chang A, Pasternak GW | title = 3-Methoxynaltrexone, a selective heroin/morphine-6beta-glucuronide antagonist | journal = FEBS Letters | volume = 412 | issue = 1 | pages = 35–8 | date = July 1997 | pmid = 9257684 | doi = 10.1016/S0014-5793(97)00710-2 | s2cid = 45475657 | doi-access = free }}
The relative strength of heterocodeine to codeine has been published as 50, 72, 81, 88, 93, 96, and 108 ×.
It is not mentioned specifically in the Controlled Substances Act 1970 but is a Schedule II controlled substance as an analogue of morphinan or morphine under the morphine structure rules of the Analogues Act; in other countries it is usually controlled as a strong opioid.
Homocodeine is a synonym for pholcodine. Bicodeine is a dimer of codeine which is essentially the codeine analogue of pseudomorphine and is also known as pseudocodeine. It is an occasional component of opium and is also a decomposition product of codeine under certain circumstances.{{cite web | title = Status Decision of Controlled and Non-Controlled Substances: Codeine dimer | work = Health Canada | date = 15 June 2005 | url = https://isomerdesign.com/Cdsa/HC/StatusDecisions/A-2013-00235%20-%20PDFs/C-Codeine%20dimer%202005-06-16.pdf}}