methyldihydromorphine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 411440855

| IUPAC_name = (5α,6α)-6,17-Dimethyl-4,5-epoxymorphinan-3,6-diol

| image = Methyldihydromorphine.svg

| image_class = skin-invert-image

| width = 180

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_BR = A1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule I

| legal_UK =

| legal_US = Schedule I

| legal_DE = Anlage I

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 509-56-8

| ATC_prefix = none

| ATC_suffix =

| PubChem = 5464303

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D12689

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 26AY9TLO5W

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4576611

| C=18 | H=23 | N=1 | O=3

| smiles = C[C@@]1(CC[C@H]2[C@H]3Cc4ccc(c5c4[C@]2([C@H]1O5)CCN3C)O)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H23NO3/c1-17(21)6-5-11-12-9-10-3-4-13(20)15-14(10)18(11,16(17)22-15)7-8-19(12)2/h3-4,11-12,16,20-21H,5-9H2,1-2H3/t11-,12+,16-,17-,18-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NBKVWIJQJMEQLE-NGTWOADLSA-N

}}

Methyldihydromorphine{{US Patent| 2104058}} is a semi-synthetic opioid originally developed in Germany in 1936, controlled under both domestic law and UN conventions because of its possible potential for abuse. Methyldihydromorphine is related to heterocodeine and is not a synonym for dihydrocodeine or dihydroheterocodeine (6-methoxydihydromorphine).

This compound is a derivative of hydromorphone{{Cite book | title = Morphine & Allied Drugs | vauthors = Reynolds AK, Randall LO | location = Toronto | publisher = University of Toronto Press | date = 1957 | page = 194}} It has been found to be 33 percent the analgesic potency of morphine with a substantially longer duration of action.

So far, little is currently known about this compound. It is a Schedule I controlled substance in the United States with an ACSCN of 9304 and a 2013 annual manufacturing quota of 2 grams.{{cite web | url = http://www.deadiversion.usdoj.gov/fed_regs/quotas/2013/fr0620.htm | title = Quotas - 2013 | work = Drug Enforcement Administration | publisher = United States Department of Justice }}