iridium(V) fluoride

{{Chembox

| Watchedfields = changed

| verifiedrevid = 431440582

| ImageFile1 = PtF5solid.tif

| ImageFile2 = Unit_cell__of_OsF5.png

| IUPACName =

| OtherNames = Iridium pentafluoride

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 14568-19-5

| PubChem =

| SMILES = F[Ir](F)(F)(F)F

| SMILES_Comment = monomer

| SMILES1 = F[Ir-]1(F)(F)(F)[F+][Ir-](F)(F)(F)(F)[F+][Ir-](F)(F)(F)(F)[F+][Ir-](F)(F)(F)(F)[F+]1

| SMILES1_Comment = tetramer

| StdInChI=1S/5FH.Ir/h5*1H;/q;;;;;+5/p-5

| StdInChIKey = AVEYGPFFIPYHQT-UHFFFAOYSA-I

}}

| Section2 = {{Chembox Properties

| Formula = IrF₅

| MolarMass = 287.209 g/mol

| Appearance = yellow solid

| Density =

| MeltingPtC = 104.5

| MeltingPt_notes =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

| Section4 = {{Chembox Related

| OtherCations = Rhodium(V) fluoride, Osmium pentafluoride, Platinum(V) fluoride

| OtherCompounds = Iridium(IV) fluoride, Iridium hexafluoride }}

}}

Iridium(V) fluoride, IrF₅, is a chemical compound of iridium and fluorine. A highly reactive yellow low melting solid, it has a tetrameric structure, Ir₄F₂₀, which contains octahedrally coordinated iridium atoms.Egon Wiberg, Arnold Frederick Holleman (2001) Inorganic Chemistry, Elsevier {{ISBN|0-12-352651-5}} This structure is shared with RuF₅ and OsF₅. It can be prepared by the controlled decomposition of IrF₆ or the reduction of IrF₆ with silicon powder or H₂ in anhydrous HF.{{cite journal | title = Reductive syntheses of transition metal fluoride compounds. Synthesis of rhenium, osmium, and iridium pentafluorides and tetrafluorides | journal = Inorganic Chemistry| volume = 14 | issue = 5 | year = 1975 | pages = 1111–1113 | doi = 10.1021/ic50147a030 | last1 = Paine | first1 = Robert T. | last2 = Asprey | first2 = Larned B.}}{{cite journal |journal=Chem. Commun. |year=1965 |pages=252–253 |doi=10.1039/C19650000252 |title=Iridium pentafluoride |first1=Neil|last1= Bartlett |first2= P. R.|last2=Rao|author1-link=Neil Bartlett (chemist)|issue=12}}

:{{chem2|2IrF6 + H2 -> 2IrF5 + 2HF}}

:{{chem2|4IrF6 + Si -> 4IrF5 + SiF4}}