loracarbef

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 462093698

| IUPAC_name = (6R,7S)-7-[[(2S)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Loracarbef.svg

| tradename = Lorabid

| Drugs.com = {{drugs.com|monograph|loracarbef}}

| MedlinePlus = a601206

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound = 25%

| metabolism =

| elimination_half-life =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 76470-66-1

| ATC_prefix = J01

| ATC_suffix = DC08

| PubChem = 5284584

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00447

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4447634

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = W72I5ZT78Z

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08143

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1013

| C=16 | H=16 | Cl=1 | N=3 | O=4

| smiles = Cl\C3=C(/C(=O)O)N2C(=O)[C@@H](NC(=O)[C@@H](c1ccccc1)N)[C@H]2CC3.O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H16ClN3O4.H2O/c17-9-6-7-10-12(15(22)20(10)13(9)16(23)24)19-14(21)11(18)8-4-2-1-3-5-8;/h1-5,10-12H,6-7,18H2,(H,19,21)(H,23,24);1H2/t10-,11-,12+;/m1./s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GPYKKBAAPVOCIW-HSASPSRMSA-N

}}

Loracarbef is an antibiotic.{{cite journal | vauthors = Biedenbach DJ, Jones RN | title = Predictive accuracy of disk diffusion test for Proteus vulgaris and Providencia species against five newer orally administered cephalosporins, cefdinir, cefetamet, cefprozil, cefuroxime, and loracarbef | journal = Journal of Clinical Microbiology | volume = 32 | issue = 2 | pages = 559–62 | date = February 1994 | pmid = 8150976 | pmc = 263078 | doi = 10.1128/JCM.32.2.559-562.1994}} It is a carbacephem, but it is sometimes grouped together with the second-generation cephalosporin antibiotics. Loracarbef is a synthetic "carba" analog of cefaclor, and is more stable.