lorpiprazole

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (5aR,8aS)-3-(2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl)-5,5a,6,7,8,8a-hexahydrocyclopenta[3,4]pyrrolo[2,1-c][1,2,4]triazole

| image = Lorpiprazole.png

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 108785-69-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3045380

| ChemSpiderID = 16736802

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0M14O7T47Q

| C=21 | H=26 | F=3 | N=5

| smiles = FC(F)(F)c1cc(ccc1)N5CCN(CCc4nnc2n4C[C@@H]3CCC[C@H]23)CC5

}}

Lorpiprazole (INN; brand name Normarex) is an anxiolytic drug of the phenylpiperazine group.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA742|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=742–}}{{cite book | vauthors = Negwer M, Scharnow HG | title = Organic-Chemical Drugs and Their Synonyms | edition = 8th | volume = 1–6 | publisher = Wiley-VCH | location = Weinheim | year = 2001 | isbn = 3-527-30247-6 | url-access = registration | url = https://archive.org/details/organicchemicald00negw }}{{cite journal | vauthors = Fagiolini A, Comandini A, Catena Dell'Osso M, Kasper S | title = Rediscovering trazodone for the treatment of major depressive disorder | journal = CNS Drugs | volume = 26 | issue = 12 | pages = 1033–49 | date = December 2012 | pmid = 23192413 | pmc = 3693429 | doi = 10.1007/s40263-012-0010-5 }} It has been described as a serotonin antagonist and reuptake inhibitor (SARI) in the same group as trazodone, nefazodone, and etoperidone.

See also

References