medazepam

{{Short description|Benzodiazepine drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 462101416

| IUPAC_name = 7-chloro-1-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepine

| image = Medazepam.svg

| image_class = skin-invert-image

| width = 170

| image2 = Medazepam ball-and-stick model.png

| tradename = Rudotel

| Drugs.com = {{drugs.com|international|medazepam}}

| pregnancy_category =

| legal_BR = B1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA = Schedule IV

| legal_DE = Rx-only/Anlage III

| legal_US = Schedule IV

| routes_of_administration = Oral

| bioavailability = 50–75% (С_max = 1–2 hours)

| protein_bound = >99%

| metabolism = Hepatic

| elimination_half-life = 2 hours, 36–150 hours (terminal)

| excretion = Renal (63–85%), Biliary 15–37%

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 2898-12-6

| ATC_prefix = N05

| ATC_suffix = BA03

| PubChem = 4041

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = none

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3901

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P0J3387W3S

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01292

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 28333

| C=16 | H=15 | Cl=1 | N=2

| smiles = ClC1=CC(C(C2=CC=CC=C2)=NCCN3C)=C3C=C1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H15ClN2/c1-19-10-9-18-16(12-5-3-2-4-6-12)14-11-13(17)7-8-15(14)19/h2-8,11H,9-10H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YLCXGBZIZBEVPZ-UHFFFAOYSA-N

}}

Medazepam is a drug that is a benzodiazepine derivative. It possesses anxiolytic, anticonvulsant, sedative, and skeletal muscle relaxant properties. It is known by the following brand names: Azepamid, Nobrium, Tranquirax (mixed with bevonium), Rudotel, Raporan, Ansilan and Mezapam.{{cite encyclopedia | url = http://www.drug-encyclopedia.eu/DW_EN/benzodiazepines.shtml | encyclopedia = Encyclopedia of Drugs | title = Benzodiazepines }} Medazepam is a long-acting benzodiazepine drug. The half-life of medazepam is 36–200 hours.{{cite web | url = http://www.bcnc.org.uk/equivalence.html | date = April 2007 | title = Benzodiazepine Equivalency Table | access-date = September 23, 2007 | first = Heather | last = Ashton | name-list-style = vanc | work = Benzodiazepines Co-operation Not Confrontation (BCNC) | archive-date = September 28, 2007 | archive-url = https://web.archive.org/web/20070928121055/http://www.bcnc.org.uk/equivalence.html | url-status = dead }}