melamine cyanurate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428736138

| Name = Melamine-cyanuric acid complex

| Reference = [http://iaspub.epa.gov/srs/srs_proc_qry.navigate?P_SUB_ID=275008 EPA: Substance :] {{webarchive|url=https://web.archive.org/web/20080922053636/http://iaspub.epa.gov/srs/srs_proc_qry.navigate?P_SUB_ID=275008 |date=2008-09-22 }}

| ImageFile = Melamine-cyanuric acid chemical structure color.png

| PIN = 1,3,5-Triazinane-2,4,6-trione—1,3,5-triazine-2,4,6-triamine (1/1)

| OtherNames = Melamine–cyanuric acid compound, melamine–cyanuric acid adduct, melamine cyanurate, melamine isocyanurate

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 37640-57-6

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 70371-20-9

| EINECS =

| PubChem = 93198

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 84141

| SMILES = c1(nc(nc(n1)N)N)N.c1(=O)[nH]c(=O)[nH]c(=O)[nH]1

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZQKXQUJXLSSJCH-UHFFFAOYSA-N

| RTECS =

| MeSHName = melamine+cyanurate

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| Formula = C₆H₉N₉O₃

(C₃H₆N₆·C₃H₃N₃O₃)

| MolarMass = 255.19 g/mol

| Appearance =

| Density =

| MeltingPtC =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = none

| SolubleOther =

| Solvent =

| pKa =

| pKb =

}}

|Section7={{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL =

}}

}}

Melamine cyanurate, also known as melamine–cyanuric acid adduct or melamine–cyanuric acid complex, is a crystalline complex formed from a 1:1 mixture of melamine and cyanuric acid. The substance is not a salt despite its non-systematic name melamine cyanurate. The complex is held together by an extensive two-dimensional network of hydrogen bonds between the two compounds, reminiscent of the guanine–cytosine base pairs found in DNA.

{{cite journal

|vauthors=Perdigão LM, Champness NR, Beton PH | year = 2006

| title = Surface self-assembly of the cyanuric acid-melamine hydrogen bonded network

| journal = Chem. Commun.

| volume =

| issue = 5

| pages = 538–540

| pmid = 16432575

| doi = 10.1039/b514389f

| url =

}}

Melamine cyanurate forms spoke-like crystals from aqueous solutions {{cite journal

| author = Lili He

| author2 = Yang Liu

| author3 = Mengshi Lin

| author4 = Joseph Awika

| author5 = David R Ledoux

| author6 = Hao Li

| author7 = Azlin Mustapha

| year = 2008

| title = A new approach to measure melamine, cyanuric acid, and melamine cyanurate using surface enhanced Raman spectroscopy coupled with gold nanosubstrates

| journal = Sens. & Instrumen. Food Qual.

| volume = 2

| issue =

| pages = 66–71

| pmid =

| doi = 10.1007/s11694-008-9038-0

| s2cid = 93425738

| url =

}}

and has been implicated as a causative agent for toxicity seen in the Chinese protein export contamination and the 2007 pet food recall. This complex is cited as an example of supramolecular chemistry.{{cite book |last=Lehn |first=J. M. |title=Supramolecular Chemistry: Concepts and Perspectives |publisher=VCH |location=Weinheim |year=1995 }}