mercury(I) nitrate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428718366

| Name = Mercury(I) nitrate

| ImageFile = Mercury(I) nitrate dihydrate.ვკ.jpg

| ImageSize =

| ImageName =

| IUPACName = Mercury(I) nitrate

| OtherNames = Mercurous nitrate

| Reference =

{{Citation

| last = Lide

| first = David R.

| author-link =

| year = 1998

| title = Handbook of Chemistry and Physics

| edition = 87

| volume =

| series =

| location = Boca Raton, Florida

| publisher = CRC Press

| id =

| isbn = 0-8493-0594-2

| doi =

| oclc =

| pages = 4–45

| url =

| accessdate =

}}

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 10415-75-5

| index_label = (anhydrous)

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 14836-60-3

| index2_label = (dihydrate)

| ChemSpiderID = 23580

| ChemSpiderID2 = 9493944

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J78005WL7R

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = Z92K1EV5HQ

| PubChem = 25247

| UNNumber = 1627

| InChI = 1S/Hg.NO3/c;2-1(3)4/q+1;-1

| InChIKey = DRXYRSRECMWYAV-UHFFFAOYSA-N

| InChI2=1S/2Hg.2NO3.2H2O/c;;2*2-1(3)4;;/h;;;;2*1H2/q2*+1;2*-1;;

| InChIKey2 = LSABZDVKJBWCBE-UHFFFAOYSA-N

| SMILES = [N+](=O)([O-])[O-].[Hg+][Hg+].[N+](=O)([O-])[O-]

| SMILES2 = [N+](=O)([O-])[O-].[OH2+][Hg][Hg][OH2+].[N+](=O)([O-])[O-]

| RTECS =

| EINECS = 233-886-4

}}

| Section2 = {{Chembox Properties

| Formula = Hg₂(NO₃)₂ (anhydrous)
Hg₂(NO₃)₂·2H₂O (dihydrate)

| MolarMass = 525.19 g/mol (anhydrous)
561.22 g/mol (dihydrate)

| Appearance = white monoclinic crystals (anhydrous)
colorless crystals (dihydrate)

| Density = ? g/cm³ (anhydrous)
4.8 g/cm³ (dihydrate)

| MeltingPt = ? (anhydrous)
decomposes at 70 °C (dihydrate)

| BoilingPt =

| Solubility = slightly soluble, reacts

| SolubleOther =

| MagSus = −27.95·10⁻⁶ cm³/mol

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct =

}}

| Section7 = {{Chembox Hazards

| GHS_ref={{cite web |title=Mercurous nitrate |url=https://pubchem.ncbi.nlm.nih.gov/compound/25247#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}

| GHSPictograms = {{GHS06}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|300|310|330|373|410}}

| PPhrases = {{P-phrases|260|262|264|270|271|273|280|284|301+316|302+352|304+340|316|319|320|321|330|361+364|391|403+233|405|501}}

| ExternalSDS =

| NFPA-H = 3

| NFPA-F = 1

| NFPA-R = 1

| NFPA-S = OX

| FlashPt =

}}

| Section8 = {{Chembox Related

| OtherAnions = Mercury(I) fluoride
Mercury(I) chloride
Mercury(I) bromide
Mercury(I) iodide

| OtherCations = Mercury(II) nitrate

}}

}}

Mercury(I) nitrate is an inorganic compound, a salt of mercury and nitric acid with the formula Hg₂(NO₃)₂. A yellow solid, the compound is used as a precursor to other Hg₂²⁺ complexes. The structure of the hydrate has been determined by X-ray crystallography. It consists of a [H₂O-Hg-Hg-OH₂]²⁺ center, with a Hg-Hg distance of 254 pm.{{cite journal |journal=Journal of the Chemical Society|title=The crystal Structure of Mercurous Nitrate Dihydrate|author=D. Grdenić|doi=10.1039/jr9560001312|year=1956|pages=1312–1316 }}

It was first mentioned by Prafulla Chandra Ray in 1896.{{Cite journal |last=Samanta |first=Subhas |last2=Goswami |first2=Sreebrata |last3=Chakravorty |first3=Animesh |date=February 2011 |title=On mercurous nitrite and a basic mercurous nitrate derivative |url=http://nopr.niscair.res.in/bitstream/123456789/11011/1/IJCA%2050A(2)%20137-140.pdf |journal=Indian Journal of Chemistry |volume=50A |issue=2 |pages=137-140 |issn=0975-0975}}