penflufen

{{Short description|Fungicide.}}

{{Chembox

| ImageFile = Penflufen structure.svg

| ImageSize =

| ImageAlt =

| IUPACName = 5-Fluoro-1,3-dimethyl-N-[2-(4-methylpentan-2-yl)phenyl]pyrazole-4-carboxamide

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 494793-67-8

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9848842

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H24FN3O/c1-11(2)10-12(3)14-8-6-7-9-15(14)20-18(23)16-13(4)21-22(5)17(16)19/h6-9,11-12H,10H2,1-5H3,(H,20,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GOFJDXZZHFNFLV-UHFFFAOYSA-N

| PubChem = 11674113

| UNII = 8252E275KT

| SMILES = CC1=NN(C(=C1C(=O)NC2=CC=CC=C2C(C)CC(C)C)F)C

}}

| Section2 = {{Chembox Properties

| C = 18 | H = 24 | F = 1 | N = 3 | O = 1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Penflufen is a fungicide which was produced and patented by Bayer AG in 2006 and is used for crop protection from fungi.{{Cite journal |last1=Tian |first1=Fajun |last2=Liu |first2=Xingang |last3=Wu |first3=Yanbing |last4=Xu |first4=Jun |last5=Dong |first5=Fengshou |last6=Wu |first6=Xiaohu |last7=Zheng |first7=Yongquan |date=December 2016 |title=Simultaneous determination of penflufen and one metabolite in vegetables and cereals using a modified quick, easy, cheap, effective, rugged, and safe method and liquid chromatography coupled to tandem mass spectrometry |url=http://dx.doi.org/10.1016/j.foodchem.2016.06.117 |journal=Food Chemistry |volume=213 |pages=410–416 |doi=10.1016/j.foodchem.2016.06.117 |pmid=27451198 |issn=0308-8146}}{{Cite journal |last=Russell |first=Phil |date=2004-06-01 |title=14th. International Reinhardsbrunn Symposium, Modern Fungicides and Antifungal Compounds, April 25–29 2004, Friedrichroda, Germany |url=http://dx.doi.org/10.1564/15jun09 |journal=Outlooks on Pest Management |volume=15 |issue=3 |pages=115–117 |doi=10.1564/15jun09 |issn=1743-1026}} Penflufen is a pyrazole-amide based succinate-dehydrogenase inhibitor, which blocks the electron transport at complex II in the mitochondrial respiration chain.{{Cite journal |last=Dewar |first=Alan M. |date=2012-06-01 |title=Crop Protection in Northern Britain: A Review of the Recent Dundee Conference |url=http://dx.doi.org/10.1564/23jun02 |journal=Outlooks on Pest Management |volume=23 |issue=3 |pages=100–101 |doi=10.1564/23jun02 |issn=1743-1026}} The European Chemical Agency (ECHA) has also approved the use of penflufen in wood preservation despite labelling it a suspected carcinogen.{{Cite web |last=ECHA |access-date = October 18, 2024 |title=ECHA substance info card on Penflufen |url=https://echa.europa.eu/substance-information/-/substanceinfo/100.113.711}}