phenestrol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [4-[4-[4-[2-[4-[Bis(2-chloroethyl)amino]phenyl]acetyl]oxyphenyl]hexan-3-yl]phenyl] 2-[4-[bis(2-chloroethyl)amino]phenyl]acetate

| image = Phenestrol.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 19659-38-2

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 161290

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 141682

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = Fenestrol; NSC-183736; hexestrol bis[4-[bis(2-chloroethyl)amino]phenylacetate

| C=42 | H=48 | Cl=4 | N=2 | O=4

| SMILES = CCC(C1=CC=C(C=C1)OC(=O)CC2=CC=C(C=C2)N(CCCl)CCCl)C(CC)C3=CC=C(C=C3)OC(=O)CC4=CC=C(C=C4)N(CCCl)CCCl

| StdInChI_Ref =

| StdInChI = 1S/C42H48Cl4N2O4/c1-3-39(33-9-17-37(18-10-33)51-41(49)29-31-5-13-35(14-6-31)47(25-21-43)26-22-44)40(4-2)34-11-19-38(20-12-34)52-42(50)30-32-7-15-36(16-8-32)48(27-23-45)28-24-46/h5-20,39-40H,3-4,21-30H2,1-2H3

| StdInChIKey_Ref =

| StdInChIKey = GTWGWCYJKHSRHO-UHFFFAOYSA-N

}}

{{Distinguish|Fenestrel}}

Phenestrol, or fenestrol, also known as hexestrol bis[4-[bis(2-chloroethyl)amino]phenylacetate, is a synthetic, nonsteroidal estrogen and cytostatic antineoplastic agent (i.e., chemotherapy drug) and a chlorphenacyl nitrogen mustard ester of hexestrol which was developed in the early 1960s for the treatment of hormone-dependent tumors but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA163|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=163–}}{{cite book| veditors = Goldin A |author1=National Cancer Institute (U.S.)|author2=Onkologicheskiĭ nauchnyĭ t͡sentr (Akademii͡a medit͡sinskikh nauk SSSR) |title=Experimental evaluation of antitumor drugs in the USA and USSR and clinical correlations |url=https://books.google.com/books?id=auZ3FSFQiT4C|year=1981|publisher=U.S. Dept. of Health and Human Services, Public Health Service, National Institutes of Health, National Cancer Institute|page=17}}{{cite journal | vauthors = Morozova TM, Merkulova TI, Martynov V, Iaguzhinskaia VP, Shkodinskaia EN | title = [Properties of alkylating derivatives of estrogens] | language = ru | journal = Eksperimental'naia Onkologiia | volume = 6 | issue = 2 | pages = 50–54 | year = 1984 | pmid = 6510335 }}{{cite journal | vauthors = Lagova ND, Sof'ina ZP, Shkodinskaia EN, Kurdiumova KN, Valueva IM | title = [The antineoplastic activity of testiphenon] | language = ru | journal = Voprosy Onkologii | volume = 34 | issue = 11 | pages = 1363–1368 | year = 1988 | pmid = 3201773 }}