prednimustine

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 434002897

| IUPAC_name = [2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-Dihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate

| image = Prednimustine.svg

| width = 250px

| tradename = Mostarina, Sterecyst

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 29069-24-7

| ATC_prefix = L01

| ATC_suffix = AA08

| PubChem = 34457

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 9403SIO2S8

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C19512

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 31708

| synonyms = EORTC 1502; Leo 1031; NSC 134087; Prednisolone 21-(4-(4-(bis(2-chloroethyl)-amino)phenyl)butanoate); 11β,17α-Dihydroxy-3,20-dioxopregna-1,4-dien-21-yl 4-{4-[bis(2-chloroethyl)amino]-phenyl}butanoate

| C=35 | H=45 | Cl=2 | N=1 | O=6

| SMILES = C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)COC(=O)CCCc4ccc(cc4)N(CCCl)CCCl)O)CCC5=CC(=O)C=C[C@]35C)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C35H45Cl2NO6/c1-33-14-12-26(39)20-24(33)8-11-27-28-13-15-35(43,34(28,2)21-29(40)32(27)33)30(41)22-44-31(42)5-3-4-23-6-9-25(10-7-23)38(18-16-36)19-17-37/h6-7,9-10,12,14,20,27-29,32,40,43H,3-5,8,11,13,15-19,21-22H2,1-2H3/t27-,28-,29-,32+,33-,34-,35-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HFVNWDWLWUCIHC-GUPDPFMOSA-N

}}

Prednimustine, sold under the brand names Mostarina and Sterecyst, is a medication which is used in chemotherapy in the treatment of leukemias and lymphomas.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1012|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=1012–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA868|year=2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=868–}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA230|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=230–}} It is the ester formed from two other drugs, prednisolone and chlorambucil. Rarely, it has been associated with myoclonus.{{cite journal | vauthors = Monnerat C, Gander M, Leyvraz S | title = A rare case of prednimustine-induced myoclonus | journal = Journal of the National Cancer Institute | volume = 89 | issue = 2 | pages = 173–174 | date = January 1997 | pmid = 8998190 | doi = 10.1093/jnci/89.2.173 | doi-access = free }}