propylphenidate

{{Distinguish|propylphenidine}}

{{Short description|Stimulant drug}}

{{Drugbox

| IUPAC_name = Propyl 2-phenyl-2-(piperidin-2-yl)acetate

| image = Propylphenidate_proper_structure.png

| image_class = skin-invert-image

| width = 220

| tradename =

| routes_of_administration =

| legal_CA = Schedule III

| legal_DE = NpSG

| legal_UK = Class B

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 1071564-47-0

| ATC_suffix =

| PubChem = 91844465

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0Q064445GT

| ChemSpiderID = 52085111

| C=16 | H=23 | N=1 | O=2

| smiles = C1(=CC=CC=C1)C(C(=O)OCCC)C2CCCCN2

| StdInChI = 1S/C16H23NO2/c1-2-12-19-16(18)15(13-8-4-3-5-9-13)14-10-6-7-11-17-14/h3-5,8-9,14-15,17H,2,6-7,10-12H2,1H3

| StdInChIKey = PRMWWEANNQSWAR-UHFFFAOYSA-N

}}

Propylphenidate (also known as PPH) is a piperidine based stimulant drug, closely related to methylphenidate, but with the methyl ester replaced by a propyl ester. It was banned in the UK as a Temporary Class Drug from April 2015 following its unapproved sale as a designer drug.[https://www.gov.uk/government/uploads/system/uploads/attachment_data/file/420983/TCDO_methylphenidate_NPS.pdf Methylphenidate-based NPS: A review of the evidence of use and harm. Advisory Council on the Misuse of Drugs, 31 March 2015]

Legal status

Propylphenidate is illegal in Sweden as of 26 January 2016,{{cite web | url=http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2015/november/31-nya-amnen-kan-klassas-som-narkotika-eller-halsofarlig-vara/ | title=31 nya ämnen kan klassas som narkotika eller hälsofarlig vara | publisher=Folkhälsomyndigheten | language=Swedish | date=November 2015}} and in Finland since 2017.{{Cite web |url=https://finlex.fi/fi/lainsaadanto/2014/1130 |title=Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista |access-date=2021-06-07 |archive-date=2023-05-01 |archive-url=https://web.archive.org/web/20230501232001/https://finlex.fi/fi/laki/ajantasa/2014/20141130#a12.11.2020-764 |url-status=live }}

See also

References