protoporphyrinogen IX

{{Chembox

| verifiedrevid = 439771218

| ImageFile = Protoporphyrinogen IX.svg

| ImageSize = 200 px

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 7412-77-3

| ChEBI = 57307

| ChemSpiderID = 20171538

| PubChem = 20849104

| StdInChI=1S/C34H40N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,35-38H,1-2,9-16H2,3-6H3,(H,39,40)(H,41,42)/p-2

| StdInChIKey = UHSGPDMIQQYNAX-UHFFFAOYSA-L

| SMILES = CC1=C2CC3=C(C(=C(N3)CC4=C(C(=C(N4)CC5=C(C(=C(N5)CC(=C1CCC(=O)[O-])N2)CCC(=O)[O-])C)C=C)C)C=C)C

| MeSHName = protoporphyrinogen

}}

|Section2={{Chembox Properties

| Formula = C34H38N4O4

| MolarMass = 566.7 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Protoporphyrinogen IX is an organic chemical compound which is produced along the synthesis of porphyrins, a class of critical biochemicals that include hemoglobin and chlorophyll. It is a direct precursor of protoporphyrin IX.

The compound is a porphyrinogen, meaning that it has a non-aromatic hexahydroporphine core, which will be oxidized to a porphine core in later stages of the heme synthesis. Like most porphyrinogens, it is colorless.{{Citation needed|reason=Source?|date=December 2021}}

Biosynthesis

The compound is synthesized in most organisms from coproporphyrinogen III by the enzyme coproporphyrinogen oxidase:

File:Proptoporphyrinogen-IX-synthesis-from-coproporphyrinogen-III.png

The process entails conversion of two of four propionic acid groups to vinyl groups. In coproporphyrinogen III, the substituents on the pyrrole rings have the arrangement MP-MP-MP-PM, where M and P are methyl and propionic acid, respectively. In protoporphyrinogen IX, the sequence becomes MV-MV-MP-PM, where V is vinyl.

By the action of protoporphyrinogen oxidase, protoporphyrinogen IX is later converted into protoporphyrin IX, the first colored tetrapyrrole in the biosynthesis of hemes.{{cite encyclopedia|chapter=Hemes in Biology|author=Paul R. Ortiz de Montellano|year=2008|encyclopedia=Wiley Encyclopedia of Chemical Biology|pages=1–10 |doi=10.1002/9780470048672.wecb221|publisher=John Wiley & Sons|isbn=978-0470048672}}

References

{{reflist}}

See also

{{Tetrapyrroles}}

{{Heme metabolism intermediates}}

{{DEFAULTSORT:Protoporphyrinogen Ix}}

Category:Macrocycles

Category:Tetrapyrroles

{{organic-compound-stub}}