rubratoxin B

{{Chembox

| ImageFile = Rubratoxin B Structure.svg

| ImageSize = 100px

| ImageAlt =

| PIN = (4R,5S,10S)-10-{(S)-[(2S)-3,6-Dihydro-6-oxopyran-2-yl](hydroxy)methyl}-4-hydroxy-5-[(1R)-1-hydroxyheptyl]-5,9,10,11-tetrahydro-1H-cyclonona[1,2-c:5,6-c′]difuran-1,3,6,8(4H)-tetrone

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 21794-01-4

| CASNo_Ref = {{Cascite|changed|CAS}}

| ChEBI = 80714

| ChemSpiderID = 10142953

| EINECS = 244-582-6

| KEGG = C16767

| PubChem = 11969548

| UNII = J38U4758MY

| SMILES = CCCCCC[C@H]([C@H]1[C@H](C2=C(C[C@H](CC3=C1C(=O)OC3=O)[C@@H]([C@@H]4CC=CC(=O)O4)O)C(=O)OC2=O)O)O

| StdInChI=1S/C26H30O11/c1-2-3-4-5-7-15(27)20-18-13(23(31)36-25(18)33)10-12(21(29)16-8-6-9-17(28)35-16)11-14-19(22(20)30)26(34)37-24(14)32/h6,9,12,15-16,20-22,27,29-30H,2-5,7-8,10-11H2,1H3/t12-,15+,16-,20+,21-,22-/m0/s1

| StdInChIKey = ZJTBTDVZNGBSNG-RETZLTROSA-N

}}

|Section2={{Chembox Properties

| C=26 | H=30 | O=11

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Rubratoxin B is mycotoxin with anticancer activity made by Penicillium rubrum. It has been reported to elicit antioxidative and DNA repair responses in mouse brain.