sergolexole

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = (4-methoxycyclohexyl) (6aR,9R,10aR)-7-methyl-4-propan-2-yl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-9-carboxylate

| image = Sergolexole_structure.png

| width = 220px

| tradename =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_US_comment =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 108674-86-8

| PubChem = 60262

| ChemSpiderID =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J6TGA89COP

| C=26 | H=36 | N=2 | O=3

| SMILES = CC(C)N1C=C2C[C@@H]3[C@H](C[C@H](CN3C)C(=O)OC4CCC(CC4)OC)C5=C2C1=CC=C5

| StdInChI = 1S/C26H36N2O3/c1-16(2)28-15-17-13-24-22(21-6-5-7-23(28)25(17)21)12-18(14-27(24)3)26(29)31-20-10-8-19(30-4)9-11-20/h5-7,15-16,18-20,22,24H,8-14H2,1-4H3/t18-,19?,20?,22-,24-/m1/s1

| StdInChIKey = RJBJIKXTJIZONR-FTNAIZGWSA-N

}}

Sergolexole (developmental code name LY-281,067) is an ergoline derivative which acts as a selective antagonist of the serotonin 5-HT₂ receptors. It has been used for various research applications, but was never developed for medical use.{{cite journal | vauthors = Cohen ML, Fuller RW, Kurz KD, Parli CJ, Mason NR, Meyers DB, Smallwood JK, Toomey RE | display-authors = 6 | title = Preclinical pharmacology of a new serotonergic receptor antagonist, LY281067 | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 244 | issue = 1 | pages = 106–12 | date = January 1988 | pmid = 3335993 }}{{cite journal | vauthors = Cohen ML, Parli CJ, Fuller RW | title = 5-Hydroxytryptamine2 receptor antagonist activity of the acid metabolite (1-isopropyl dihydrolysergic acid) of the ergoline ester, sergolexole (LY281067) | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 251 | issue = 3 | pages = 1006–11 | date = December 1989 | pmid = 2600800 }}{{cite journal | vauthors = Koba S, Pakala R, Watanabe T, Katagiri T, Benedict CR | title = Vascular smooth muscle proliferation: synergistic interaction between serotonin and low density lipoproteins | journal = Journal of the American College of Cardiology | volume = 34 | issue = 5 | pages = 1644–51 | date = November 1999 | pmid = 10551718 | doi = 10.1016/s0735-1097(99)00349-6 | doi-access = | s2cid = 24224564 }}