sofalcone

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 448141641

| IUPAC_name = [5-[(3-Methylbut-2-en-1-yl)oxy]-2-((2E)-3-{4-[(3-methylbut-2-en-1-yl)oxy]phenyl}prop-2-enoyl)phenoxy]acetic acid

| image = Sofalcone.svg

| tradename =

| Drugs.com = {{drugs.com|international|sofalcone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 153175-87-2

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 5282219

| ChEBI = 135732

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2B668TJX8E

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01956

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4445402

| C=27 | H=30 | O=6

| smiles = CC(=CCOC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OCC=C(C)C)OCC(=O)O)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C27H30O6/c1-19(2)13-15-31-22-8-5-21(6-9-22)7-12-25(28)24-11-10-23(32-16-14-20(3)4)17-26(24)33-18-27(29)30/h5-14,17H,15-16,18H2,1-4H3,(H,29,30)/b12-7+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GFWRVVCDTLRWPK-KPKJPENVSA-N

}}

Sofalcone (INN) is an oral gastrointestinal medication used in Japan.{{cite web | url = https://www.drugs.com/international/sofalcone.html | title = Sofalcone | publisher = drugs.com}} It is a synthetic analog of sophoradin,{{cite journal |vauthors=Konturek SJ, Mrzozowski T, Drozdowicz D, Pawlik W, Sendur R |title=Gastroprotective and ulcer healing effects of solon, a synthetic flavonoid derivative of sophoradin |journal=Hepatogastroenterology |volume=34 |issue=4 |pages=164–70 |date=August 1987 |pmid=3478294 }} a type of natural phenol found in Sophora tonkinensis, an herb used in traditional Chinese medicine.