strontium nitrate
{{cs1 config|name-list-style=vanc}}
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477000320
| ImageFile = Sr(NO3)2.png
| ImageFile1 = Strontium-nitrate-unit-cell-3D-balls.png
| ImageSize =
| IUPACName = Strontium nitrate
| OtherNames =
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23231
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BDG873AQZL
| InChI = 1/2NO3.Sr/c2*2-1(3)4;/q2*-1;+2
| InChIKey = DHEQXMRUPNDRPG-UHFFFAOYAG
| SMILES = [Sr+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2NO3.Sr/c2*2-1(3)4;/q2*-1;+2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DHEQXMRUPNDRPG-UHFFFAOYSA-N
| CASNo = 10042-76-9
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 24848
| EINECS = 233-131-9
}}
| Section2 = {{Chembox Properties
| Formula = Sr(NO3)2
| MolarMass = 211.630 g/mol (anhydrous)
283.69 g/mol (tetrahydrate)
| Appearance = white crystalline solid
| Density = 2.986 g/cm3 (anhydrous)
2.20 g/cm3 (tetrahydrate)Patnaik, Pradyot (2002). Handbook of Inorganic Chemicals. McGraw-Hill, {{ISBN|0-07-049439-8}}
| MeltingPtC = 570
| MeltingPt_notes = (anhydrous)
100 °C, decomposes (tetrahydrate)
| BoilingPtC = 645
| BoilingPt_notes = decomposes
| Solubility = anhydrous:
710 g/L (18 °C)
660 g/L (20 °C)
tetrahydrate:
604.3 g/L (0 °C)
2065 g/L (100 °C)
| SolubleOther = soluble in ammonia
very slightly soluble in ethanol, acetone
insoluble in nitric acid
| MagSus = −57.2·10−6 cm3/mol
}}
| Section3 = {{Chembox Structure
| CrystalStruct = cubic (anhydrous)
monoclinic (tetrahydrate)
}}
| Section7 = {{Chembox Hazards
| ExternalSDS = [http://www.sciencelab.com/msds.php?msdsId=9927283]
| MainHazards = Irritant
| NFPA-H = 2
| NFPA-F = 0
| NFPA-R = 0
| NFPA-S = OX
| FlashPt = Non-flammable
| LD50 = 2750 mg/kg (rat, oral)
}}
| Section8 = {{Chembox Related
| OtherAnions = Strontium sulfate
Strontium chloride
| OtherCations = Beryllium nitrate
Magnesium nitrate
Calcium nitrate
Barium nitrate
}}
}}
Strontium nitrate is an inorganic compound composed of the elements strontium, nitrogen and oxygen with the formula Sr(NO3)2. This colorless solid is used as a red colorant and oxidizer in pyrotechnics.
Preparation
Strontium nitrate is typically generated by the reaction of nitric acid on strontium carbonate.{{Cite book | doi = 10.1002/9780470132340.ch4 |author1=Ward, R. |author2=Osterheld, R. K. |author3=Rosenstein, R. D. |chapter=Strontium Sulfide and Selenide Phosphors | title = Inorganic Syntheses | year = 1950 | volume = 3 | pages = 11–23 | series = Inorganic Syntheses | isbn = 978-0-470-13234-0 }}
: 2 HNO3 + SrCO3 → Sr(NO3)2 + H2O + CO2
File:Strontium Carbonate and Nitric acid.jpg
{{clear|left}}
Uses
Like many other strontium salts, strontium nitrate is used to produce a rich red flame in fireworks and road flares. The oxidizing properties of this salt are advantageous in such applications.MacMillan, J. Paul; Park, Jai Won; Gerstenberg, Rolf; Wagner, Heinz; Köhler, Karl and Wallbrecht, Peter (2002) "Strontium and Strontium Compounds" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a25_321}}
Strontium nitrate can aid in eliminating and lessening skin irritations. When mixed with glycolic acid, strontium nitrate reduces the sensation of skin irritation significantly better than using glycolic acid alone.{{cite journal|vauthors=Zhai H, Hannon W, Hahn GS, Pelosi A, Harper RA, Maibach HI |title = Strontium nitrate suppresses chemically-induced sensory irritation in humans|year=2000|volume=42|pages=98–100| pmid = 10703633|issue=2|journal=Contact Dermatitis|doi=10.1034/j.1600-0536.2000.042002098.x| s2cid=25910851 }}
Biochemistry
As a divalent ion with an ionic radius similar to that of Ca2+ (1.13 Å and 0.99 Å respectively), Sr2+ ions resembles calcium's ability to traverse calcium-selective ion channels and trigger neurotransmitter release from nerve endings. It is thus used in electrophysiology experiments.
In popular culture
In his short story "A Germ-Destroyer", Rudyard Kipling refers to strontium nitrate as the main ingredient of the titular fumigant.