testosterone glucuronide
{{Chembox
| ImageFile = Testosterone glucuronide.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 3-Oxoandrost-4-en-17β-yl β-D-glucopyranosiduronic acid
| SystematicName = (2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-
| OtherNames = Androst-4-en-17β-ol-3-one 17β-D-glucuronide
| Section1 = {{Chembox Identifiers
| CASNo = 1180-25-2
| ChemSpiderID = 97270
| ChEBI = 28835
| ChEMBL =
| KEGG = C11134
| PubChem = 108192
| StdInChI = 1S/C25H36O8/c1-24-9-7-13(26)11-12(24)3-4-14-15-5-6-17(25(15,2)10-8-16(14)24)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h11,14-21,23,27-29H,3-10H2,1-2H3,(H,30,31)/t14-,15-,16-,17-,18-,19-,20+,21-,23+,24-,25-/m0/s1
| StdInChIKey = NIKZPECGCSUSBV-HMAFJQTKSA-N
| SMILES = [H][C@@]12CC[C@H](O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C
| UNII =
}}
| Section2 = {{Chembox Properties
| C=25 | H=36 | O=8
| MolarMass = 464.555 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Testosterone glucuronide is an endogenous, naturally occurring steroid and minor urinary metabolite of testosterone.{{cite HMDB|author1-link=David S. Wishart|url=http://www.hmdb.ca/metabolites/hmdb03193|title=Showing metabocard for Testosterone glucuronide (HMDB03193)}}
See also
References
{{Reflist}}
{{Steroid hormones}}
{{steroid-stub}}
{{biochemistry-stub}}