testosterone ketolaurate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (1S,2R,10R,11S,14S,15S)-2,15-dimethyl-5-oxotetracyclo[8.7.0.02,7.011,15]heptadec-6-en-14-yl 3-oxododecanoate
| image = Testosterone ketolaurate.svg
| image_class = skin-invert-image
| width = 250
| tradename = Androdurin, Testosid-Depot
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Intramuscular injection
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 5874-98-6
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| PubChem = 68644
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 61901
| UNII = 1LOH6F419Q
| ChEMBL = 1697795
| KEGG = D06085
| synonyms =
| C=31 | H=48 | O=4
| SMILES = CCCCCCCCCC(=O)CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C
| StdInChI_Ref =
| StdInChI = 1S/C31H48O4/c1-4-5-6-7-8-9-10-11-23(32)21-29(34)35-28-15-14-26-25-13-12-22-20-24(33)16-18-30(22,2)27(25)17-19-31(26,28)3/h20,25-28H,4-19,21H2,1-3H3/t25-,26-,27-,28-,30-,31-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = LTGBMQYUNNUCHA-DQUDHZTESA-N
}}
Testosterone ketolaurate (INN, USAN) (brand names Androdurin, Testosid-Depot (with testosterone propionate)), also known as testosterone caprinoylacetate, is an androgen and anabolic steroid medication and a testosterone ester.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–642}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA976|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA270|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1}} It was introduced in 1956.{{cite book|author=United States. Patent Office|title=Official Gazette of the United States Patent Office|url=https://archive.org/details/officialgazette708unit|year=1956|publisher=U.S. Patent Office.}} It was marketed both as an oil solution and as a crystalline aqueous suspension.{{cite book| vauthors = Jores A, Nowakowski H |title=Praktische Endokrinologie|url=https://books.google.com/books?id=QhdsAAAAMAAJ|year=1960|publisher=G. Thieme|page=297}}
See also
References
{{Reflist}}
{{Androgens and antiandrogens}}
{{Androgen receptor modulators}}
Category:Anabolic–androgenic steroids
{{Genito-urinary-drug-stub}}
{{Steroid-stub}}