theasinensin A

{{Short description|Chemical compound}}

{{Chembox

| Name = Theasinensin A

| OtherNames = (1M)-6,6′-Bis{(2R,3R)-5,7-dihydroxy-3-[(3,4,5-trihydroxybenzoyl)oxy]-3,4-dihydro-2H-1-benzopyran-2-yl}-[1,1′-biphenyl]-2,2′,3,3′,4,4′-hexol

| ImageFile = Theasinensin A.svg

| Section1 = {{Chembox Identifiers

| CASNo = 89064-31-3

| PubChem = 442543

| ChEBI = 9518

| ChEMBL = 349197

| KEGG = C09972

| ChemSpiderID = 390965

| StdInChI=1S/C44H34O22/c45-15-5-21(47)17-11-31(65-43(61)13-1-23(49)35(55)24(50)2-13)41(63-29(17)7-15)19-9-27(53)37(57)39(59)33(19)34-20(10-28(54)38(58)40(34)60)42-32(12-18-22(48)6-16(46)8-30(18)64-42)66-44(62)14-3-25(51)36(56)26(52)4-14/h1-10,31-32,41-42,45-60H,11-12H2/t31-,32-,41-,42-/m1/s1

| StdInChIKey = YUULFXAQUWEYNP-GXAWFILRSA-N

| SMILES = C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3C4=C(C(=C(C=C4C5C(CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)O)O)O

}}

| Section2 = {{Chembox Properties

| C=44 | H=34 | O=22

}}

}}

Theasinensin A is polyphenol flavonoid from black tea (Camellia sinensis) created during fermentation, by oxidation of epigallocatechin gallate.

Its atropisomer is theasinensin D.

See also

References

  • {{Cite journal| doi = 10.1248/cpb.31.3906| volume = 31| issue = 11| pages = 3906–3914| last1 = Nonaka| first1 = Genichiro| last2 = Kawahara| first2 = Osamu| last3 = Nishioka| first3 = Itsuo| title = Tannins and Related Compounds. XV. A New Class of Dimeric Flavan-3-ol Gallates, Theasinensins A and B, and Proanthocyanidin Gallates from Green Tea Leaf. (1)| journal = Chemical and Pharmaceutical Bulletin| accessdate = 2018-11-26| date = 1983-11-25| url = https://www.jstage.jst.go.jp/article/cpb1958/31/11/31_11_3906/_article/-char/ja/| doi-access = free}}
  • {{Cite journal| doi = 10.1248/cpb.36.1676| volume = 36| issue = 5| pages = 1676–1684| last1 = Hashimoto| first1 = Fumio| last2 = Nonaka| first2 = Gen-Ichiro| last3 = Nishioka| first3 = Itsuo| title = Tannins and Related Compounds. LXIX. : Isolation and Structure Elucidation of B, B'-Linked Bisflavanoids, Theasinensins D-G and Oolongtheanin from Oolong Tea. (2)| journal = Chemical and Pharmaceutical Bulletin| accessdate = 2018-11-26| date = 1988-05-25| url = https://www.jstage.jst.go.jp/article/cpb1958/36/5/36_5_1676/_article/-char/ja/| doi-access = free}}
  • {{cite book|author1=John Buckingham|author2=V. Ranjit N. Munasinghe|title=Dictionary of Flavonoids with CD-ROM|date=26 November 2018|publisher=CRC Press|isbn=978-1-4822-8250-4|page=892}}

Category:Flavanols

Category:Polyphenols

Category:Biphenyls

{{organic-compound-stub}}