tin(II) sulfate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477315237

| Name = Tin(II) sulfate

| ImageFile = Zinn(II)-sulfat.png

| ImageAlt = Tin(II) sulfate crystallizes in an heavily distorted barium sulfrate structure.

| ImageCaption = Unit cell of tin(II) sulfate.

| ImageName = Tin(II) sulfate

| OtherNames = Stannous sulfate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106484

| InChI = 1/H2O4S.Sn.2H/c1-5(2,3)4;;;/h(H2,1,2,3,4);;;/q;+2;;/p-2/rH2O4S.H2Sn/c1-5(2,3)4;/h(H2,1,2,3,4);1H2/q;+2/p-2

| InChIKey = RCIVOBGSMSSVTR-YHUAHBEBAB

| SMILES = [O-]S(=O)(=O)[O-].[SnH2+2]

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/H2O4S.Sn.2H/c1-5(2,3)4;;;/h(H2,1,2,3,4);;;/q;+2;;/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RCIVOBGSMSSVTR-UHFFFAOYSA-L

| CASNo = 7488-55-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0MFE10J96E

| EINECS = 231-302-2

| PubChem = 62643

}}

|Section2={{Chembox Properties

| Formula = SnSO₄

| MolarMass = 214.773 g/mol

| Appearance = white-yellowish crystalline solid
deliquescent

| Density = 4.15 g/cm³

| Solubility = 33 g/100 mL (25 °C)

| MeltingPtC = 378

| BoilingPt = decomposes to SnO₂ and SO₂

}}

|Section3={{Chembox Structure

|Structure_ref = {{Cite journal|doi=10.1107/S0567740872003322|title=The crystal structure of tin(II) sulphate|year=1972|last1=Donaldson|first1=J. D.|last2=Puxley|first2=D. C.|journal=Acta Crystallographica Section B: Structural Crystallography and Crystal Chemistry|volume=28|issue=3|pages=864–867|bibcode=1972AcCrB..28..864D }}

|CrystalStruct = Primitive orthorhombic

|LattConst_a = 8.80 Å

|LattConst_b = 5.32 Å

|LattConst_c = 7.12 Å

|LattConst_ref = {{Cite journal|doi=10.1107/S0567740872003322|title=The crystal structure of tin(II) sulphate|year=1972|last1=Donaldson|first1=J. D.|last2=Puxley|first2=D. C.|journal=Acta Crystallographica Section B: Structural Crystallography and Crystal Chemistry|volume=28|issue=3|pages=864–867|bibcode=1972AcCrB..28..864D }}

|SpaceGroup = Pnma, No. 62

}}

|Section7={{Chembox Hazards

| NFPA-H = 1

| NFPA-F = 0

| NFPA-R = 0

| FlashPt = Non-flammable

| LD50 = 2207 mg/kg (oral, rat)
2152 mg/kg (oral, mouse){{IDLH|7440315|Tin (inorganic compounds, as Sn)}}

}}

|Section8={{Chembox Related

| OtherAnions = Tin(II) chloride, tin(II) bromide, tin(II) iodide

| OtherCations = Lead(II) sulfate

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Tin(II) sulfate (SnSO₄) is a chemical compound. It is a white solid that can absorb enough moisture from the air to become fully dissolved, forming an aqueous solution; this property is known as deliquescence. It can be prepared by a displacement reaction between metallic tin and copper(II) sulfate:{{Greenwood&Earnshaw1st|page=451}}

:{{chem2 | Sn (s) + CuSO4 (aq) -> Cu (s) + SnSO4 (aq) }}

Tin(II) sulfate is a convenient source of tin(II) ions uncontaminated by tin(IV) species.