triphenyltin hydride

{{chembox

| Watchedfields = changed

| verifiedrevid = 444238331

| ImageFile = Ph3SnH.png

| ImageSize = 160

| ImageAlt = Skeletal formula of triphenyltin hydride

| ImageFile1 = Triphenyltin-hydride-3D-spacefill.png

| ImageSize1 = 180

| ImageAlt1 = Space-filling model of the triphenyltin hydride molecule

| IUPACName = Triphenylstannane

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 892-20-6

| Beilstein = 3544353

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 30537

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6217

| EINECS = 212-967-8

| Gmelin = 6741

| RTECS = WH8882000

| PubChem = 6460

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 95T92AGN0V

| SMILES2 = c1c(cccc1)[Sn](c2ccccc2)c3ccccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/3C6H5.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1-5H;;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NFHRNKANAAGQOH-UHFFFAOYSA-N

| SMILES = [H][Sn](C2=CC=CC=C2)(C3=CC=CC=C3)C1=CC=CC=C1

}}

|Section2={{Chembox Properties

| C=18 | H=16 | Sn=1

| Appearance = colorless

| Density = 1.374 g/cm³

| Solubility = insoluble

| Solvent = benzene, THF

| SolubleOther = soluble

| MeltingPtC = 28

| MeltingPt_notes =

| BoilingPtC = 156

| BoilingPt_notes = (0.15 mm Hg)

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards = toxic

| FlashPt = >230 °F

| GHSPictograms = {{GHS06}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|311|331|410}}

| PPhrases = {{P-phrases|}}

}}

|Section8={{Chembox Related

| OtherCompounds = SnCl₄,
(C₆H₅)₃SnCl,
(C₆H₅)₃SnOH

}}

}}

Triphenyltin hydride is the organotin compound with the formula (C₆H₅)₃SnH. It is a colorless distillable oil that is soluble in organic solvents. It is often used as a source of "H·" to generate radicals or cleave carbon-oxygen bonds.