zuomihuanglong

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Use mdy dates|date=November 2024}}

{{chembox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| Name = Zuomihuanglong

| ImageFile = Zuomihuanglong structure.svg

| ImageSize = 200px

| ImageName = Skeletal formula of zuomihuanglong

| ImageFile1 =

| ImageSize1 = 200px

| ImageName1 =

| PIN = Methyl 5-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}-1-(2-pyridyl)-1H-pyrazole-4-carboxylate

| OtherNames =

| Section1={{Chembox Identifiers

| CASNo = 104770-29-8

| CASNo_Ref =

| IUPHAR_ligand =

| ChEBI =

| ChemSpiderID = 160336

| PubChem = 184404

| UNII =

| StdInChI = 1S/C17H17N7O5S/c1-10-8-11(2)21-16(20-10)22-17(26)23-30(27,28)14-12(15(25)29-3)9-19-24(14)13-6-4-5-7-18-13/h4-9H,1-3H3,(H2,20,21,22,23,26)

| StdInChIKey = KABSXJFKDZOTFH-UHFFFAOYSA-N

| ChEMBL_Ref =

| ChEMBL =

| SMILES = CC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=NN2C3=CC=CC=N3)C(=O)OC)C

}}

| Section2={{Chembox Properties

| C=17 | H=17 | O=5 | N=7 | S=1

| Appearance =

| Odor =

| Density =

| Solubility =

| SolubleOther =

| MeltingPtC =

| MeltingPt_ref =

| BoilingPtC =

| BoilingPt_ref =

| Viscosity =

| VaporPressure =

| ThermalConductivity =

| LogP =

| pKa =

| RefractIndex =

}}

| Section3={{Chembox Thermochemistry

| DeltaHc =

| HeatCapacity =

| DeltaHf =

}}

| Section4={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| FlashPtC =

| FlashPt_ref =

| NFPA_ref =

| LD50 =

}}

}}

Zuomihuanglong ({{langx|zh|唑嘧磺隆}}) is an herbicide approved for use in China.{{Cite web|url=http://www.bcpcpesticidecompendium.org/zuomihuanglong.html |title=Zuomihuanglong |website=Compendium of Pesticide Common Names |publisher=British Crop Production Council |access-date=27 November 2024}} It is a sulfonylurea compound, and its formula is {{chem2|C17H17N7O5S}}.

Its mechanism of action is the inhibition of acetolactate synthase and acetohydroxyacid synthase.{{Cite journal |last1=Forouzesh |first1=A |last2=Zand |first2=E |last3=Soufizadeh |first3=S |last4=Samadi Foroushani |first4=S |date=August 2015 |editor-last=Barriuso |editor-first=Enrique |title=Classification of herbicides according to chemical family for weed resistance management strategies – an update |url=https://onlinelibrary.wiley.com/doi/10.1111/wre.12153 |journal=Weed Research |language=en |volume=55 |issue=4 |pages=334–358 |doi=10.1111/wre.12153 |bibcode=2015WeedR..55..334F |issn=0043-1737}}

References