zuomihuanglong
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Use mdy dates|date=November 2024}}
{{chembox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| Name = Zuomihuanglong
| ImageFile = Zuomihuanglong structure.svg
| ImageSize = 200px
| ImageName = Skeletal formula of zuomihuanglong
| ImageFile1 =
| ImageSize1 = 200px
| ImageName1 =
| PIN = Methyl 5-{[(4,6-dimethylpyrimidin-2-yl)carbamoyl]sulfamoyl}-1-(2-pyridyl)-1H-pyrazole-4-carboxylate
| OtherNames =
| Section1={{Chembox Identifiers
| CASNo = 104770-29-8
| CASNo_Ref =
| IUPHAR_ligand =
| ChEBI =
| ChemSpiderID = 160336
| PubChem = 184404
| UNII =
| StdInChI = 1S/C17H17N7O5S/c1-10-8-11(2)21-16(20-10)22-17(26)23-30(27,28)14-12(15(25)29-3)9-19-24(14)13-6-4-5-7-18-13/h4-9H,1-3H3,(H2,20,21,22,23,26)
| StdInChIKey = KABSXJFKDZOTFH-UHFFFAOYSA-N
| ChEMBL_Ref =
| ChEMBL =
| SMILES = CC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=NN2C3=CC=CC=N3)C(=O)OC)C
}}
| Section2={{Chembox Properties
| C=17 | H=17 | O=5 | N=7 | S=1
| Appearance =
| Odor =
| Density =
| Solubility =
| SolubleOther =
| MeltingPtC =
| MeltingPt_ref =
| BoilingPtC =
| BoilingPt_ref =
| Viscosity =
| VaporPressure =
| ThermalConductivity =
| LogP =
| pKa =
| RefractIndex =
}}
| Section3={{Chembox Thermochemistry
| DeltaHc =
| HeatCapacity =
| DeltaHf =
}}
| Section4={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| FlashPtC =
| FlashPt_ref =
| NFPA_ref =
| LD50 =
}}
}}
Zuomihuanglong ({{langx|zh|唑嘧磺隆}}) is an herbicide approved for use in China.{{Cite web|url=http://www.bcpcpesticidecompendium.org/zuomihuanglong.html |title=Zuomihuanglong |website=Compendium of Pesticide Common Names |publisher=British Crop Production Council |access-date=27 November 2024}} It is a sulfonylurea compound, and its formula is {{chem2|C17H17N7O5S}}.
Its mechanism of action is the inhibition of acetolactate synthase and acetohydroxyacid synthase.{{Cite journal |last1=Forouzesh |first1=A |last2=Zand |first2=E |last3=Soufizadeh |first3=S |last4=Samadi Foroushani |first4=S |date=August 2015 |editor-last=Barriuso |editor-first=Enrique |title=Classification of herbicides according to chemical family for weed resistance management strategies – an update |url=https://onlinelibrary.wiley.com/doi/10.1111/wre.12153 |journal=Weed Research |language=en |volume=55 |issue=4 |pages=334–358 |doi=10.1111/wre.12153 |bibcode=2015WeedR..55..334F |issn=0043-1737}}