:3C-P

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477220361

| IUPAC_name = 1-(3,5-Dimethoxy-4-propoxyphenyl)propan-2-amine

| image = 3C-P_2d-skeletal.svg

| width = 200

| tradename =

| legal_DE = NpSG

| legal_UK = Class A

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 501700-11-4

| PubChem = 54929142

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106238

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4KRX4MHV7L

| C=14 | H=23 | N=1 | O=3

| smiles = CC(N)Cc1cc(OC)c(OCCC)c(c1)OC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H23NO3/c1-5-6-18-14-12(16-3)8-11(7-10(2)15)9-13(14)17-4/h8-10H,5-7,15H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KKMCHCCXGKYEKJ-UHFFFAOYSA-N

}}

3C-P, also known as 4-propoxy-3,5-dimethoxyamphetamine, is a psychedelic phenethylamine. It has structural and pharmacodynamic properties similar to the drugs mescaline, proscaline, and amphetamine. Little information exists on the human pharmacology of 3C-P, but a psychedelic dosage appears to be 20–40 mg,{{cite journal | vauthors = Halberstadt AL, Chatha M, Klein AK, Wallach J, Brandt SD | title = Correlation between the potency of hallucinogens in the mouse head-twitch response assay and their behavioral and subjective effects in other species | journal = Neuropharmacology | volume = 167 | issue = | pages = 107933 | date = May 2020 | pmid = 31917152 | pmc = 9191653 | doi = 10.1016/j.neuropharm.2019.107933 | url = http://usdbiology.com/cliff/Courses/Advanced%20Seminars%20in%20Neuroendocrinology/Serotonergic%20Psychedelics%2020/Halberstadt%2020%20Neuropharm%20potency%20of%20hallucinogens%20%20head-twitch.pdf | quote = Table 4 Human potency data for selected hallucinogens. [...] }} and is accompanied by stimulant and psychedelic effects such as visual enhancement and distortion.{{medcn|date=February 2018}} It can be synthesized from syringaldehyde by reaction with n-propyl iodide followed by condensation with nitroethane and reduction.{{cite journal| vauthors = Trachsel D |title=Synthese von neuen (Phenylalkyl)aminen zur Untersuchung von Struktur-Aktivitätsbeziehungen, Mitteilung 1, Mescalin Derivate|journal=Helvetica Chimica Acta|date=September 2002|volume=85|issue=9|pages=3019–3026|doi=10.1002/1522-2675(200209)85:9<3019::AID-HLCA3019>3.0.CO;2-4}} 3C-P acts as a serotonin 5-HT₂ receptor agonist.{{cite journal | vauthors = Wallach J, Cao AB, Calkins MM, Heim AJ, Lanham JK, Bonniwell EM, Hennessey JJ, Bock HA, Anderson EI, Sherwood AM, Morris H, de Klein R, Klein AK, Cuccurazzu B, Gamrat J, Fannana T, Zauhar R, Halberstadt AL, McCorvy JD | title = Identification of 5-HT2A receptor signaling pathways associated with psychedelic potential | journal = Nat Commun | volume = 14 | issue = 1 | pages = 8221 | date = December 2023 | pmid = 38102107 | pmc = 10724237 | doi = 10.1038/s41467-023-44016-1 | url = https://bitnest.netfirms.com/external/10.1038/s41467-023-44016-1}}

3C-P has been sold online as a designer drug as was first detected in September 2013 in Finland.{{Cite web |title=EMCDDA–Europol 2013 Annual Report on the implementation of Council Decision 2005/387/JHA {{!}} www.euda.europa.eu |url=https://www.euda.europa.eu/publications/implementation-reports/2013_en |access-date=2025-05-11 |website=www.euda.europa.eu}}