:Phyllodulcin

{{chembox

| Watchedfields = changed

| verifiedrevid = 442172331

| Name = Phyllodulcin

| ImageFile = Phyllodulcin.svg

| ImageSize = 200px

| ImageName = Chemical structure of phyllodulcin

| ImageAlt = Chemical structure of hyllodulcin

| PIN = (3R)-8-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-1H-2-benzopyran-1-one

| OtherNames = Praeruptorin

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 21499-23-0

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9DDW04R41V

| PubChem = 146694

| ChemSpiderID = 129391

| SMILES = COc1ccc(cc1O)[C@H]2Cc3cccc(c3C(=O)O2)O

| StdInChI = 1S/C16H14O5/c1-20-13-6-5-9(7-12(13)18)14-8-10-3-2-4-11(17)15(10)16(19)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m1/s1

| StdInChIKey = PBILBHLAPJTJOT-CQSZACIVSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₁₆H₁₄O₅

| MolarMass = 286.27 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Phyllodulcin is a dihydroisocoumarin found in Hydrangea macrophyllaEffects of phyllodulcin, hydrangenol, and their 8-O-glucosides, and Thunberginols A and F from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol. 22, no. 8, pp. 870–872, {{INIST|1959604}}. and Hydrangea serrata.Accumulation of phyllodulcin in sweet-leaf plants of Hydrangea serrata and its neutrality in the defence against a specialist leafmining herbivore. Mami Ujihara, Masateru Shinozaki and Makoto Kato, Researches on population ecology, Volume 37, Number 2, pp. 249–257, {{doi|10.1007/BF02515827}}. It is a sweetener 400–800 times sweeter than sugar.Chemical and Functional Properties of Food Saccharides. P. Tomasik, CRC Press, Boca Raton, 2003, {{ISBN|978-0-8493-1486-5}}.