:Pregnenolone sulfate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 377858355

| ImageFile = Pregnenolone sulfate.svg

| ImageSize = 240

| ImageAlt = Skeletal formula

| ImageFile1 = Pregnenolone sulfate anion ball.png

| ImageSize1 = 230

| ImageAlt1 = Ball-and-stick model of pregnenolone sulfate as an anion

| IUPACName = 20-Oxopregn-5-en-3β-yl hydrogen sulfate

| SystematicName = (1S,3aS,3bS,7S,9aR,9bS,11aS)-1-Acetyl-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl hydrogen sulfate

| OtherNames = Pregn-sulf; Pregnenolone monosulfate; Pregnenolone hydrogen sulfate; Pregnenolone 3β-sulfate; 5-Pregnen-3β-ol-20-one sulfate; (3β)-3-(Sulfooxy)pregn-5-en-20-one; 5-Pregnen-3β-sulfate-20-one; 20-Oxo-5-pregnen-3β-yl sulfate

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 4290

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 1247-64-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 04Y4D91RG0

| PubChem = 105074

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 141573

| SMILES = CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OS(=O)(=O)O)C)C

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 94802

| InChI = 1/C21H32O5S/c1-13(22)17-6-7-18-16-5-4-14-12-15(26-27(23,24)25)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,15-19H,5-12H2,1-3H3,(H,23,24,25)/t15-,16-,17+,18-,19-,20-,21+/m0/s1

| InChIKey = DIJBBUIOWGGQOP-QGVNFLHTBX

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H32O5S/c1-13(22)17-6-7-18-16-5-4-14-12-15(26-27(23,24)25)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,15-19H,5-12H2,1-3H3,(H,23,24,25)/t15-,16-,17+,18-,19-,20-,21+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DIJBBUIOWGGQOP-QGVNFLHTSA-N

}}

|Section2={{Chembox Properties

| C=21 | H=32 | O=5 | S=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Pregnenolone sulfate (PS, PREGS) is an endogenous excitatory neurosteroid that is synthesized from pregnenolone.{{cite journal | author = Harteneck C | title = Pregnenolone sulfate: from steroid metabolite to TRP channel ligand | journal = Molecules | volume = 18 | issue = 10 | pages = 12012–28 | year = 2013 | pmid = 24084011 | doi = 10.3390/molecules181012012|pmc=6270300 | doi-access = free }}{{cite journal | author = Reddy DS | title = Neurosteroids: endogenous role in the human brain and therapeutic potentials | journal = Prog. Brain Res. | volume = 186 | pages = 113–37 | year = 2010 | pmid = 21094889 | pmc = 3139029 | doi = 10.1016/B978-0-444-53630-3.00008-7 }} It is known to have cognitive and memory-enhancing, antidepressant, anxiogenic, and proconvulsant effects.