:Protostane

{{short description|Chemical compound}}

{{Chembox

| ImageFile = Protostane.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = Protostane{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1539 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

| SystematicName = (1R,3aS,3bS,5aS,9aS,9bS,11aS)-3a,3b,6,6,9a-Pentamethyl-1-[(2R)-6-methylheptan-2-yl]hexadecahydro-1H-cyclopenta[a]phenanthrene

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 70050-78-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7F8LXZ75AX

| PubChem = 9548716

| Beilstein =

| KEGG =

| ChEBI = 36483

| StdInChI= 1S/C30H54/c1-21(2)11-9-12-22(3)23-15-19-29(7)24(23)13-14-26-28(6)18-10-17-27(4,5)25(28)16-20-30(26,29)8/h21-26H,9-20H2,1-8H3/t22-,23-,24+,25+,26+,28+,29+,30+/m1/s1

| StdInChIKey= OORMXZNMRWBSTK-XJIBWFFZSA-N

| SMILES = C[C@H](CCCC(C)C)[C@H]1CC[C@]2([C@H]1CC[C@@H]3[C@@]2(CC[C@@H]4[C@@]3(CCCC4(C)C)C)C)C

| ChemSpiderID = 7827639

}}

|Section2={{Chembox Properties

| C=30 | H=54

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Protostane is a tetracyclic triterpene, its natural distribution is primarily limited to the genus Alisma. It is so named because it is considered to be the "prototype" of steroids.{{Cite journal| vauthors= Zhao M, Gödecke T, Gunn J, Duan JA, Che CT | title = Protostane and Fusidane Triterpenes: A Mini-Review | journal = Molecules | year = 2013 | volume = 18 | issue = 4 | pages = 4054–4080 | doi = 10.3390/molecules18044054 | pmid = 23563857 | pmc = 3901436 | doi-access = free }}