1H-LSD

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = (6aR,9R)-N,N-diethyl-6-methyl-4-hexanoyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide

| image = 1H-LSD_structure.png

| width = 220

| tradename =

| legal_AU =

| legal_BR =

| legal_CA =

| legal_DE = NpSG

| legal_UK = PSA

| legal_US = Unscheduled (may be covered by the Federal Analogue Act if sold for human consumption)

| legal_UN = Unscheduled

| legal_US_comment =

| routes_of_administration =

| CAS_number =

| PubChem = 170763690

| ChemSpiderID =

| UNII =

| C=26 | H=35 | N=3 | O=2

| smiles = CN1CC(C=C2[C@H]1Cc1cn(C(=O)CCCCC)c3cccc2c31)C(=O)N(CC)CC

| StdInChI = InChI=1S/C26H35N3O2/c1-5-8-9-13-24(30)29-17-18-15-23-21(20-11-10-12-22(29)25(18)20)14-19(16-27(23)4)26(31)28(6-2)7-3/h10-12,14,17,19,23H,5-9,13,15-16H2,1-4H3/t19?,23-/m1/s1

| StdInChIKey = RSBBZALMPUUEKF-LEQGEALCSA-N

}}

1H-LSD (N1-hexanoyl-lysergic acid diethylamide, SYN-L-027){{cite patent | country = WO | number = 2024028495 | inventor = Stratford A, Williamson JP | assign = Synex Holdings BV | title = Prodrugs of Substituted Ergolines | url = https://patents.google.com/patent/WO2024028495A1/en?oq=WO2024028495 | pubdate = 8 February 2024 }} is an acylated derivative of lysergic acid diethylamide (LSD), with a six carbon hexanoyl chain attached to the N1 position. It acts as a prodrug for LSD, and in animal studies produces drug-appropriate responding with a similar potency to short-chain homologues such as ALD-52 and 1P-LSD, in contrast to the 4 and 5 carbon homologues 1B-LSD and 1V-LSD which are several times weaker.{{cite journal | vauthors = Brandt SD, Kavanagh PV, Gare S, Stratford A, Halberstadt AL | title = Analytical and behavioral characterization of 1-hexanoyl-LSD (1H-LSD) | journal = Drug Testing and Analysis | volume = | issue = | pages = | date = July 2024 | pmid = 38965834 | doi = 10.1002/dta.3767 | url = https://researchonline.ljmu.ac.uk/id/eprint/23720/1/Analytical%20and%20behavioral%20characterization%20of%201%E2%80%90hexanoyl%E2%80%90LSD%20%201H%E2%80%90LSD.pdf }}