2-Me-PVP

{{Short description|Stimulant designer drug of the substituted cathinone class}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = 1-(2-methylphenyl)-2-pyrrolidin-1-ylpentan-1-one

| image = 2Me-PVP_structure.png

| image_class = skin-invert-image

| width = 200px

| tradename =

| routes_of_administration =

| legal_UK = Class B

| legal_DE = Anlage II

| CAS_number = 850352-54-4

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = DRY2E23E56

| PubChem = 11311147

| ChemSpiderID = 9486115

| C=16 | H=23 | N=1 | O=1

| StdInChI=1S/C16H23NO/c1-3-8-15(17-11-6-7-12-17)16(18)14-10-5-4-9-13(14)2/h4-5,9-10,15H,3,6-8,11-12H2,1-2H3

| StdInChIKey = VVIVTDYOMWHKAE-UHFFFAOYSA-N

| SMILES = CCCC(C(=O)C1=CC=CC=C1C)N2CCCC2

}}

2-Methyl-alpha-PVP (2-Me-PVP) is a substituted cathinone derivative with stimulant effects which has been sold as a designer drug. It was first identified in Sweden in 2021.{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/14637/20222218_PDF_TD0522113ENN_002.pdf | title = New psychoactive substances: 25 years of early warning and response in Europe. An update from the EU Early Warning System | publisher = European Monitoring Centre for Drugs and Drug Addiction | date = June 2022 | isbn = 978-92-9497-737-3 | doi = 10.2810/882318 | author1 = European Monitoring Centre for Drugs and Drug Addiction. | doi-broken-date = 2024-11-02 }}{{cite journal | vauthors = Kuropka P, Zawadzki M, Szpot P | title = A review of synthetic cathinones emerging in recent years (2019-2022) | journal = Forensic Toxicology | pages = 25–46 | date = September 2022 | volume = 41 | issue = 1 | doi = 10.1007/s11419-022-00639-5 | pmid = 36124107 | pmc = 9476408 }}