3F-PVP

{{Short description|Substituted cathinone stimulant drug}}

{{Distinguish|3F-PCP}}

{{drugbox

| drug_name = 3-Fluoro-α-PVP

| image = 3-F-aPVP.svg

| image_class = skin-invert-image

| legal_CA = Schedule I

| legal_DE = NpSG

| legal_UK = Class B

| C = 15

| H = 20

| F = 1

| N = 1

| O = 1

| IUPAC_name = 1-(3-fluorophenyl)-2-(pyrrolidin-1-yl)pentan-1-one

| CAS_number = 2725852-55-9

| ChemSpiderID = 107437100

| PubChem = 137700196

| smiles = CCCC(C(=O)c1cccc(F)c1)N1CCCC1

| StdInChI = 1S/C15H20FNO/c1-2-6-14(17-9-3-4-10-17)15(18)12-7-5-8-13(16)11-12/h5,7-8,11,14H,2-4,6,9-10H2,1H3

| StdInChIKey = GPAALPLKXRJJDE-UHFFFAOYSA-N

}}

3-Fluoro-α-Pyrrolidinovalerophenone (3F-PVP) is a recreational designer drug from the substituted cathinone family with stimulant effects, which first appeared on the illicit market in around 2018.[https://drugsdata.org/view.php?id=6288 Drugsdata.org 3F-a-PVP (3-Fluoro-a-PVP). Sold as: 3F-A-PVP. 4 June 2018][https://knowdrugs.app/drugs/bErymwScqVFvesJKvgR3/3F-a-PVP Knowdrugs.app Warnings: 3F-a-PVP. 22 June 2018] It is illegal in Finland.[https://finlex.fi/fi/lainsaadanto/2014/1130 Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista]

See also

References