3-Me-PVP

{{Short description|Chemical compound}}

{{cs1 config |name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = 1-(3-methylphenyl)-2-pyrrolidin-1-ylpentan-1-one

| image = 3Me-PVP_structure.png

| image_class = skin-invert-image

| width = 200px

| tradename =

| routes_of_administration =

| legal_UK = Class B

| legal_DE = Anlage II

| CAS_number = 13415-85-5

| UNII_Ref =

| UNII =

| PubChem = 11470616

| ChemSpiderID = 9645446

| ChEMBL = 204254

| C=16 | H=23 | N=1 | O=1

| StdInChI=1S/C16H23NO/c1-3-7-15(17-10-4-5-11-17)16(18)14-9-6-8-13(2)12-14/h6,8-9,12,15H,3-5,7,10-11H2,1-2H3

| StdInChIKey = HHSYAWUBPBEDMP-UHFFFAOYSA-N

| SMILES = CCCC(C(=O)C1=CC=CC(=C1)C)N2CCCC2

}}

3-Methyl-alpha-PVP (3-Me-PVP, O-2480) is a substituted cathinone derivative with stimulant effects,{{cite journal | vauthors = Meltzer PC, Butler D, Deschamps JR, Madras BK | title = 1-(4-Methylphenyl)-2-pyrrolidin-1-yl-pentan-1-one (Pyrovalerone) analogues: a promising class of monoamine uptake inhibitors | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 4 | pages = 1420–32 | date = February 2006 | pmid = 16480278 | pmc = 2602954 | doi = 10.1021/jm050797a }} which has been sold as a designer drug. It was first identified in Sweden in June 2023.{{cite web | url = https://www.euda.europa.eu/sites/default/files/pdf/31883_en.pdf?606797 | title = New psychoactive substances - the current situation in Europe | work = European Drug Report | publisher = European Union Drugs Agency (EUDA) | date = 2024 }}

See also

References