25T7-NBOMe

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{drugbox

| drug_name = 25T7-NBOMe

| image = 25T7-NBOMe_structure.png

| width = 250px

| legal_AU =

| legal_BR = F2

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_EU =

| legal_UN =

| C = 21 | H = 29 | N = 1 | O = 3 | S =1

| IUPAC_name = 2-(2,5-dimethoxy-4-propylsulfanylphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine

| CAS_number = 1539266-55-1

| CAS_number_Ref = {{cascite|correct|CAS}}

| ChEMBL =

| ChemSpiderID =

| PubChem = 125181253

| UNII =

| smiles = CCCSC1=C(C=C(C(=C1)OC)CCNCC2=CC=CC=C2OC)OC

| StdInChI = 1S/C21H29NO3S/c1-5-12-26-21-14-19(24-3)16(13-20(21)25-4)10-11-22-15-17-8-6-7-9-18(17)23-2/h6-9,13-14,22H,5,10-12,15H2,1-4H3

| StdInChIKey = CPVMNHOHOSNFOP-UHFFFAOYSA-N

}}

25T7-NBOMe (also known as 2C-T-7-NBOMe or NBOMe-2C-T-7) is a substituted phenethylamine derivative from the 25-NB family. It acts as an agonist at the 5-HT_2A and 5-HT_2C serotonin receptors,{{cite journal | vauthors = Pottie E, Poulie CB, Simon IA, Harpsøe K, D'Andrea L, Komarov IV, Gloriam DE, Jensen AA, Kristensen JL, Stove CP | title = Structure-Activity Assessment and In-Depth Analysis of Biased Agonism in a Set of Phenylalkylamine 5-HT2A Receptor Agonists | journal = ACS Chemical Neuroscience | volume = 14 | issue = 15 | pages = 2727–2742 | date = August 2023 | pmid = 37474114 | pmc = 10401645 | doi = 10.1021/acschemneuro.3c00267 }} has psychedelic effects and has been sold as a designer drug.{{cite journal | vauthors = Botch-Jones S, Foss J, Barajas D, Kero F, Young C, Weisenseel J | title = The detection of NBOMe designer drugs on blotter paper by high resolution time-of-flight mass spectrometry (TOFMS) with and without chromatography | journal = Forensic Science International | volume = 267 | issue = | pages = 89–95 | date = October 2016 | pmid = 27572638 | doi = 10.1016/j.forsciint.2016.08.008 }}{{cite journal | vauthors = Grumann C, Auwärter V | title = Separation of positional isomers of nine 2-phenethylamine-derived designer drugs by liquid chromatography-tandem mass spectrometry | journal = Drug Testing and Analysis | volume = 10 | issue = 7 | pages = 1184–1191 | date = February 2018 | pmid = 29455470 | doi = 10.1002/dta.2371 }}{{cite journal | vauthors = Fan SY, Zang CZ, Shih PH, Ko YC, Hsu YH, Lin MC, Tseng SH, Wang DY | title = Simultaneous LC-MS/MS screening for multiple phenethylamine-type conventional drugs and new psychoactive substances in urine | journal = Forensic Science International | volume = 325 | issue = | pages = 110884 | date = August 2021 | pmid = 34245937 | doi = 10.1016/j.forsciint.2021.110884 | s2cid = 235791505 }}