25T4-NBOMe

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = 25T4-NBOMe_structure.png

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Serotonin 5-HT₂ receptor agonist; Serotonergic psychedelic; Hallucinogen

| ATC_prefix = None

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1354632-17-9

| CAS_supplemental =

| PubChem = 125181243

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID =

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 2C-T-4-NBOMe; NBOMe-2C-T-4

| IUPAC_name = 2-(2,5-dimethoxy-4-propan-2-ylsulfanylphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine

| C=21 | H=29 | N=1 | O=3 | S=1

| SMILES = CC(C)SC1=C(C=C(C(=C1)OC)CCNCC2=CC=CC=C2OC)OC

| StdInChI = 1S/C21H29NO3S/c1-15(2)26-21-13-19(24-4)16(12-20(21)25-5)10-11-22-14-17-8-6-7-9-18(17)23-3/h6-9,12-13,15,22H,10-11,14H2,1-5H3

| StdInChIKey = BOWHVFJVXBVJCU-UHFFFAOYSA-N

}}

25T4-NBOMe is a serotonergic psychedelic of the 25-NB (NBOMe) family.{{cite journal | vauthors = Gil-Martins E, Barbosa DJ, Borges F, Remião F, Silva R | title = Toxicodynamic insights of 2C and NBOMe drugs - Is there abuse potential? | journal = Toxicology Reports | volume = 14 | issue = | pages = 101890 | date = June 2025 | pmid = 39867514 | pmc = 11762925 | doi = 10.1016/j.toxrep.2025.101890 | bibcode = 2025ToxR...1401890G }}{{cite journal | vauthors = Zawilska JB, Kacela M, Adamowicz P | title = NBOMes-Highly Potent and Toxic Alternatives of LSD | journal = Frontiers in Neuroscience | volume = 14 | issue = | pages = 78 | date = 2020 | pmid = 32174803 | pmc = 7054380 | doi = 10.3389/fnins.2020.00078 | doi-access = free }}{{cite journal | vauthors = Kyriakou C, Marinelli E, Frati P, Santurro A, Afxentiou M, Zaami S, Busardo FP | title = NBOMe: new potent hallucinogens--pharmacology, analytical methods, toxicities, fatalities: a review | journal = European Review for Medical and Pharmacological Sciences | volume = 19 | issue = 17 | pages = 3270–3281 | date = September 2015 | pmid = 26400534 | doi = }}{{cite journal | vauthors = Awuchi CG, Aja MP, Mitaki NB, Morya S, Amagwula IO, Echeta CK, Igwe VS | title=New Psychoactive Substances: Major Groups, Laboratory Testing Challenges, Public Health Concerns, and Community-Based Solutions | journal=Journal of Chemistry | volume=2023 | date=2 February 2023 | issn=2090-9071 | doi=10.1155/2023/5852315 | doi-access=free | pages=1–36 | s2cid=256567458 }} It is the NBOMe analogue of 2C-T-4. The drug acts as a highly potent and selective agonist of the serotonin 5-HT₂ receptors.{{cite journal | vauthors = Rickli A, Luethi D, Reinisch J, Buchy D, Hoener MC, Liechti ME | title = Receptor interaction profiles of novel N-2-methoxybenzyl (NBOMe) derivatives of 2,5-dimethoxy-substituted phenethylamines (2C drugs) | journal = Neuropharmacology | volume = 99 | issue = | pages = 546–553 | date = December 2015 | pmid = 26318099 | doi = 10.1016/j.neuropharm.2015.08.034 | url = http://edoc.unibas.ch/56163/1/20170921163006_59c3cceeb8e5d.pdf }}{{cite journal | vauthors = Åstrand A, Guerrieri D, Vikingsson S, Kronstrand R, Green H | title = In vitro characterization of new psychoactive substances at the μ-opioid, CB1, 5HT_1A, and 5-HT_2A receptors-On-target receptor potency and efficacy, and off-target effects | journal = Forensic Science International | volume = 317 | issue = | pages = 110553 | date = December 2020 | pmid = 33160102 | doi = 10.1016/j.forsciint.2020.110553 }} Its reported actve dose range has been described as 150 to 1,200{{nbsp}}μg, with a typical dose estimate of 500{{nbsp}}μg.{{cite journal | vauthors = Luethi D, Liechti ME | title = Monoamine Transporter and Receptor Interaction Profiles in Vitro Predict Reported Human Doses of Novel Psychoactive Stimulants and Psychedelics | journal = The International Journal of Neuropsychopharmacology | volume = 21 | issue = 10 | pages = 926–931 | date = October 2018 | pmid = 29850881 | pmc = 6165951 | doi = 10.1093/ijnp/pyy047 }} 25T4-NBOMe was first described in the scientific literature by at least 2012.{{cite journal | vauthors = Casale JF, Hays PA | date = 2012 | title = Characterization of eleven 2, 5-dimethoxy-N-(2-methoxybenzyl) phenethylamine (NBOMe) derivatives and differentiation from their 3-and 4-methoxybenzyl analogues—part I. | journal = Microgram Journal | volume = 9 | issue = 2 | pages = 84–109 | url = https://www.dea.gov/sites/default/files/pr/microgram-journals/2012/mj9_84-109.pdf }}