25T2-NBOMe

{{Infobox drug

| drug_name =

| image = 25T2-NBOMe structure.png

| width = 250px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Serotonin 5-HT₂ receptor agonist; Serotonergic psychedelic; Hallucinogen

| ATC_prefix = None

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1391492-27-5

| CAS_supplemental =

| PubChem = 129514317

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID =

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 2C-T-2-NBOMe; NBOMe-2C-T-2; N-(2-Methoxybenzyl)-4-ethylthio-2,5-dimethoxyphenethylamine

| IUPAC_name = 2-(4-ethylsulfanyl-2,5-dimethoxyphenyl)-N-[(2-methoxyphenyl)methyl]ethanamine

| C=20 | H=27 | N=1 | O=3 | S=1

| SMILES = CCSC1=C(C=C(C(=C1)OC)CCNCC2=CC=CC=C2OC)OC

| StdInChI = 1S/C20H27NO3S/c1-5-25-20-13-18(23-3)15(12-19(20)24-4)10-11-21-14-16-8-6-7-9-17(16)22-2/h6-9,12-13,21H,5,10-11,14H2,1-4H3

| StdInChIKey = OZEBFZPAWCXEGK-UHFFFAOYSA-N

}}

25T2-NBOMe is a serotonergic psychedelic of the 25-NB (NBOMe) family.{{cite journal | vauthors = Herian M, Świt P | title = 25X-NBOMe compounds - chemistry, pharmacology and toxicology. A comprehensive review | journal = Crit Rev Toxicol | volume = 53 | issue = 1 | pages = 15–33 | date = January 2023 | pmid = 37115704 | doi = 10.1080/10408444.2023.2194907 | url = }}{{cite journal | vauthors = Gil-Martins E, Barbosa DJ, Borges F, Remião F, Silva R | title = Toxicodynamic insights of 2C and NBOMe drugs - Is there abuse potential? | journal = Toxicol Rep | volume = 14 | issue = | pages = 101890 | date = June 2025 | pmid = 39867514 | pmc = 11762925 | doi = 10.1016/j.toxrep.2025.101890 | bibcode = 2025ToxR...1401890G }}{{cite journal | vauthors = Zawilska JB, Kacela M, Adamowicz P | title = NBOMes-Highly Potent and Toxic Alternatives of LSD | journal = Front Neurosci | volume = 14 | issue = | pages = 78 | date = 2020 | pmid = 32174803 | pmc = 7054380 | doi = 10.3389/fnins.2020.00078 | doi-access = free }}{{cite journal | vauthors = Kyriakou C, Marinelli E, Frati P, Santurro A, Afxentiou M, Zaami S, Busardo FP | title = NBOMe: new potent hallucinogens--pharmacology, analytical methods, toxicities, fatalities: a review | journal = Eur Rev Med Pharmacol Sci | volume = 19 | issue = 17 | pages = 3270–3281 | date = September 2015 | pmid = 26400534 | doi = | url = https://www.europeanreview.org/wp/wp-content/uploads/3270-3281.pdf}}{{cite book | vauthors = Halberstadt AL | chapter = Pharmacology and Toxicology of N-Benzylphenethylamine ("NBOMe") Hallucinogens | title = Neuropharmacology of New Psychoactive Substances (NPS) | series = Curr Top Behav Neurosci | volume = 32 | pages = 283–311 | date = 2017 | pmid = 28097528 | doi = 10.1007/7854_2016_64 | isbn = 978-3-319-52442-9 | url = }}{{cite journal | vauthors = Marchi NC, Scherer JN, Fara LS, Remy L, Ornel R, Reis M, Zamboni A, Paim M, Fiorentin TR, Wayhs CA, Von Diemen L, Pechansky F, Kessler FH, Limberger RP | title = Clinical and Toxicological Profile of NBOMes: A Systematic Review | journal = Psychosomatics | volume = 60 | issue = 2 | pages = 129–138 | date = 2019 | pmid = 30606495 | doi = 10.1016/j.psym.2018.11.002 | url = }} It is the NBOMe analogue of 2C-T-2. The drug acts as a highly potent and selective agonist of the serotonin 5-HT₂ receptors.{{cite journal | vauthors = Rickli A, Luethi D, Reinisch J, Buchy D, Hoener MC, Liechti ME | title = Receptor interaction profiles of novel N-2-methoxybenzyl (NBOMe) derivatives of 2,5-dimethoxy-substituted phenethylamines (2C drugs) | journal = Neuropharmacology | volume = 99 | issue = | pages = 546–553 | date = December 2015 | pmid = 26318099 | doi = 10.1016/j.neuropharm.2015.08.034 | url = http://edoc.unibas.ch/56163/1/20170921163006_59c3cceeb8e5d.pdf}} Its reported active dose range has been described as 100 to 1,000{{nbsp}}μg, with a typical dose estimate of 500{{nbsp}}μg.{{cite journal | vauthors = Luethi D, Liechti ME | title = Monoamine Transporter and Receptor Interaction Profiles in Vitro Predict Reported Human Doses of Novel Psychoactive Stimulants and Psychedelics | journal = Int J Neuropsychopharmacol | volume = 21 | issue = 10 | pages = 926–931 | date = October 2018 | pmid = 29850881 | pmc = 6165951 | doi = 10.1093/ijnp/pyy047 }} 25T2-NBOMe was first described in the scientific literature by at least 2012.Casale, J. F., & Hays, P. A. (2012). Characterization of eleven 2, 5-dimethoxy-N-(2-methoxybenzyl) phenethylamine (NBOMe) derivatives and differentiation from their 3-and 4-methoxybenzyl analogues—part I. Microgram Journal, 9(2), 84–109. https://www.dea.gov/sites/default/files/pr/microgram-journals/2012/mj9_84-109.pdf