4-HO-PiPT

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = 3-{2-[(propan-2-yl)(propyl)amino]ethyl}-1H-indol-4-ol

| image = 4-HO-PiPT.svg

| width =

| tradename =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2767428-88-4

| PubChem = 166468747

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID =

| ChEMBL =

| C=16 | H=24 | N=2 | O=1

| smiles = CC(C)N(CCC)CCc1c[NH]c2cccc(O)c21

| StdInChI = 1S/C16H24N2O/c1-4-9-18(12(2)3)10-8-13-11-17-14-6-5-7-15(19)16(13)14/h5-7,11-12,17,19H,4,8-10H2,1-3H3

| StdInChIKey = CUTUPKOZXNFVHK-UHFFFAOYSA-N

}}

4-Hydroxy-N-propyl-N-isopropyltryptamine (4-HO-PiPT, Piprocin) is a substituted tryptamine derivative which is claimed to have psychedelic effects.[https://patents.google.com/patent/WO2024042239A1 Morrison J. Glycosylated psilocin derivatives and methods of use. WO 2024/042239A1] It acts as a 5-HT_2A receptor agonist, with an EC₅₀ of 13.8 nM and an efficacy of 104.8% (vs 5-HT),[https://patents.google.com/patent/WO2023115167A1 Banister S, Jorgensen W, Jinlong T. Compounds. Patent WO 2023/115167] and has been sold as a designer drug, first being identified in 2021 in British Columbia, Canada.{{cite report | url = https://www.bccsu.ca/wp-content/uploads/2022/07/BCCSU_BCs_Annual_Drug_Checking_Report2022.pdf | vauthors = Knill A, Tobias S, Matthews J, Ti L | title = A Report on British Columbia's Unregulated Drug Supply. Drug checking trends across British Columbia, January to December 2021. | date = June 2022 | work = British Columbia Centre on Substance Use }}