Clotizolam

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-Chloro-4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine

| image = Ro11-1465_structure.png

| image_class = skin-invert-image

| width = 140

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_CA = Schedule IV

| legal_DE = NpSG

| legal_UK = PSA

| legal_status =

| routes_of_administration =

| addiction_liability =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 54123-06-7

| ATC_prefix =

| ATC_suffix =

| PubChem = 3041455

| ChemSpiderID = 2304724

| UNII =

| C=15 | H=10 | Cl=2 | N=4 | S=1

| melting_point = 205

| smiles = CC1=NN=C2N1C3=C(C=C(S3)Cl)C(=NC2)C4=CC=CC=C4Cl

| StdInChI=1S/C15H10Cl2N4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)16)10-6-12(17)22-15(10)21(8)13/h2-6H,7H2,1H3

| StdInChIKey = CHGXYVPOFYZWRH-UHFFFAOYSA-N

}}

Clotizolam (Ro11-1465) is a thienotriazolodiazepine derivative first invented in the 1970s, which in more recent years has been sold as a designer drug. As with other related thienotriazolodiazepines, it produces sedative, anxiolytic, anticonvulsant and muscle relaxant effects,{{cite patent | url = https://patents.google.com/patent/US4155913A | inventor = Hellerbach J, Zeller P, Binder D, Hromatka O | assign1 = Hoffmann La Roche Inc | gdate = 22 May 1979 | title = Thienotriazolodiazepine derivatives | country = US | number = 4155913 | postscript = . }} and also acts as an inhibitor of platelet-activating factor (PAF).{{cite journal | vauthors = Tahara T, Mikashima H, Terasawa M, Maruyama Y | title = PAF antagonistic activity of some thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepines | journal = Chemical & Pharmaceutical Bulletin | volume = 35 | issue = 5 | pages = 2119–21 | date = May 1987 | pmid = 3664818 | doi = 10.1248/cpb.35.2119 | s2cid = 27564672 | doi-access = free }}