Fluclotizolam

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-chloro-4-(2-fluorophenyl)-9-methyl-4H-thieno[3,2-f] [1,2,4]triazolo[4,3-a] [1,4]diazepine

| image = Fluclotizolam Structure.svg

| image_class = skin-invert-image

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_CA = Schedule IV

| legal_DE = NpSG

| legal_UK = PSA

| legal_status =

| routes_of_administration =

| addiction_liability =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 54123-15-8

| ATC_prefix =

| ATC_suffix =

| PubChem = 21317700

| ChemSpiderID = 15332007

| UNII = 4Z9Y7GEG8Z

| C=15 | H=10 | Cl=1 | F=1 | N=4 | S=1

| melting_point =

| smiles = Fc4ccccc4C2=NCc1nnc(C)n1c3sc(Cl)cc23

| StdInChI=1S/C15H10ClFN4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)17)10-6-12(16)22-15(10)21(8)13/h2-6H,7H2,1H3

| StdInChIKey = ZDYRCUZZLRLMHG-UHFFFAOYSA-N

}}

Fluclotizolam is a thienotriazolodiazepine derivative which was first synthesised in 1979,{{cite patent | inventor = Hellerbach J, Zeller P, Binder D, Hromatka O | assign1 = Hoffmann La Roche Inc | gdate = 22 May 1979 | title = Thienotriazolodiazepine derivatives. | country = US | number = 4155913 }} but was never marketed. It has subsequently been sold as a designer drug, first being definitively identified in 2017.{{cite journal | vauthors = Zawilska JB, Wojcieszak J | title = An expanding world of new psychoactive substances-designer benzodiazepines | journal = Neurotoxicology | volume = 73 | pages = 8–16 | date = July 2019 | pmid = 30802466 | doi = 10.1016/j.neuro.2019.02.015 | s2cid = 73461430 }}{{cite book | vauthors = Moosmann B, Auwärter V | date = 2018 | chapter = Designer Benzodiazepines: Another Class of New Psychoactive Substances. | veditors = Maurer H, Brandt S | title = New Psychoactive Substances | series = Handbook of Experimental Pharmacology | volume = 252 | pages = 383–410 | doi = 10.1007/164_2018_154 | pmid = 30367253 | isbn = 978-3-030-10560-0 }}{{cite journal | vauthors = Chetraru E, Ameline A, Gheddar L, Raul JS, Kintz P | title = Les designer benzodiazepines: qu'en sait-on aujourd'hui?. | journal = Toxicologie Analytique et Clinique | date = February 2018 | volume = 30 | issue = 1 | pages = 5–18 | doi = 10.1016/j.toxac.2017.12.001 }}{{cite journal | vauthors = Orsolini L, Corkery JM, Chiappini S, Guirguis A, Vento A, De Berardis D, Papanti D, Schifano F | display-authors = 6 | title = 'New/Designer Benzodiazepines': An Analysis of the Literature and Psychonauts' Trip Reports | journal = Current Neuropharmacology | volume = 18 | issue = 9 | pages = 809–837 | date = 2020 | pmid = 31933443 | pmc = 7569319 | doi = 10.2174/1570159X18666200110121333 }}{{cite journal | vauthors = Catalani V, Botha M, Corkery JM, Guirguis A, Vento A, Scherbaum N, Schifano F | title = The Psychonauts' Benzodiazepines; Quantitative Structure-Activity Relationship (QSAR) Analysis and Docking Prediction of Their Biological Activity | journal = Pharmaceuticals | volume = 14 | issue = 8 | page = 720 | date = July 2021 | pmid = 34451817 | pmc = 8398354 | doi = 10.3390/ph14080720 | doi-access = free }}{{cite journal | vauthors = Catalani V, Floresta G, Botha M, Corkery JM, Guirguis A, Vento A, Abbate V, Schifano F | display-authors = 6 | title = In silico studies on recreational drugs: 3D quantitative structure activity relationship prediction of classified and de novo designer benzodiazepines | journal = Chemical Biology & Drug Design | volume = 101 | issue = 1 | pages = 40–51 | date = January 2023 | pmid = 35838189 | doi = 10.1111/cbdd.14119 | hdl-access = free | s2cid = 250559695 | hdl = 2299/25749 }}