Cloxestradiol acetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,13S,14S,17S)-17-(1-Acetyloxy-2,2,2-trichloroethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate

| image = Cloxestradiol acetate.svg

| width = 250px

| tradename = Genovul

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = X (Contraindicated)

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen; Estrogen ester; Estrogen ether

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 15686-44-9

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CWU34U962K

| ATC_prefix =

| ATC_suffix =

| PubChem = 71586995

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 34989697

| synonyms = 17-(2,2,2-Trichloroethoxy)estradiol O,O-diacetate; 1-{[(17β)-3-Acetoxyestra-1,3,5(10)-trien-17-yl]oxy}-2,2,2-trichloroethyl acetate

| C=24 | H=29 | Cl=3 | O=5

| SMILES = CC(=O)OC1=CC2=C(C=C1)C3CCC4(C(C3CC2)CCC4OC(C(Cl)(Cl)Cl)OC(=O)C)C

| StdInChI = 1S/C24H29Cl3O5/c1-13(28)30-16-5-7-17-15(12-16)4-6-19-18(17)10-11-23(3)20(19)8-9-21(23)32-22(24(25,26)27)31-14(2)29/h5,7,12,18-22H,4,6,8-11H2,1-3H3/t18-,19-,20+,21+,22?,23+/m1/s1

| StdInChIKey = UEVLJPRROXDIPO-CUFSGNDSSA-N

}}

Cloxestradiol acetate (brand name Genovul), also known as 17-(2,2,2-trichloroethoxy)estradiol O,O-diacetate, is a synthetic steroidal estrogen derived from estradiol.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA308|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=308–}} It is the O,O-diacetate ester of cloxestradiol, which, in contrast to cloxestradiol acetate, was never marketed.