DOPF

{{Short description|Substituted amphetamine designer drug}}

{{drugbox

| drug_name = DOPF

| image = DOPF_structure.png

| legal_UK =

| legal_DE =

| C = 14 | H = 22 | F = 1 | N = 1 | O = 2

| IUPAC_name = 2-[4-(3-fluoropropyl)-2,5-dimethoxyphenyl]ethanamine

| CAS_number =

| ChemSpiderID =

| PubChem = 163192484

| synonyms = 2,5-Dimethoxy-4-(3-fluoropropyl)amphetamine

| smiles = COc1cc(CCCF)c(cc1CC(C)N)OC

| StdInChI=1S/C14H22FNO2/c1-10(16)7-12-9-13(17-2)11(5-4-6-15)8-14(12)18-3/h8-10H,4-7,16H2,1-3H3

| StdInChIKey = UIHSFMYQJAKMHD-UHFFFAOYSA-N

}}

2,5-Dimethoxy-4-(3-fluoropropyl)amphetamine (DOPF) is a designer drug from the amphetamine and DOx families. It was first synthesised by Alexander Shulgin and David Nichols in 1989 but was never published at the time, and was finally disclosed in Daniel Trachsel's review of the field in 2013. It has a binding affinity (K_i) of 9 nM at the serotonin receptor 5-HT_2A but is not known to have been tested in humans.{{cite book | vauthors = Trachsel D, Lehmann D, Enzensperger C | title = Phenethylamine Von der Struktur zur Funktion | trans-title = Phenethylamine From structure to function | language = German | page = 778-780 | publisher = Nachtschatten Verlag AG | date = 2013 | isbn = 978-3-03788-700-4 }}