Enbezotinib

{{Short description|Chemical compound}}

{{infobox drug

| drug_name = Enbezotinib

| image = Enbezotinib_structure.png

| legal_UK =

| legal_DE =

| C = 21 | H = 21 | F = 1 | N = 6 | O = 3

| IUPAC_name = (15aR,18aS,5S)-35-fluoro-5-methyl-15a,17,18,18a-tetrahydro-16H-4-oxa-7-aza-1(5,3)-cyclopenta[b]pyrazolo[1',5':1,2]pyrimido[4,5-e][1,4]oxazina-3(3,2)-pyridinacyclooctaphan-8-one

| CAS_number = 2359649-81-1

| CAS_number_Ref = {{Cascite|correct|UNII}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6EVK907XR

| CAS_supplemental = 2359650-19-2

| ChemSpiderID =

| PubChem = 146662764

| ChEMBL =

| smiles = C[C@H]1CNC(=O)C2=C3N=C4C(=CN3N=C2)O[C@H]5CCC[C@H]5N4CC6=C(O1)N=CC(=C6)F

| StdInChI = 1S/C21H21FN6O3/c1-11-6-23-20(29)14-8-25-28-10-17-19(26-18(14)28)27(15-3-2-4-16(15)31-17)9-12-5-13(22)7-24-21(12)30-11/h5,7-8,10-11,15-16H,2-4,6,9H2,1H3,(H,23,29)/t11-,15+,16-/m0/s1

| StdInChIKey = BYYQDEOVMILBQT-XZJROXQQSA-N

}}

Enbezotinib (TPX-0046) is an experimental anticancer medication which acts as a RET inhibitor, as well as an inhibitor of SRC kinase.{{cite journal | vauthors = Repetto M, Crimini E, Ascione L, Boscolo Bielo L, Belli C, Curigliano G | title = The return of RET GateKeeper mutations? an in-silico exploratory analysis of potential resistance mechanisms to novel RET macrocyclic inhibitor TPX-0046 | journal = Investigational New Drugs | volume = 40 | issue = 5 | pages = 1133–1136 | date = October 2022 | pmid = 35612671 | doi = 10.1007/s10637-022-01259-x | s2cid = 246502280 }}{{cite journal | vauthors = Gou Q, Gan X, Li L, Gou Q, Zhang T | title = Precious Gene: The Application of RET-Altered Inhibitors | journal = Molecules (Basel, Switzerland) | volume = 27 | issue = 24 | date = December 2022 | page = 8839 | pmid = 36557971 | pmc = 9784389 | doi = 10.3390/molecules27248839 | doi-access = free }}

See also

References

{{reflist}}

{{antineoplastic-drug-stub}}

Category:Enzyme inhibitors

Category:Experimental drugs