Zeteletinib

{{Short description|Chemical compound}}

{{infobox drug

| drug_name = Zeteletinib

| image = Zeteletinib_structure.png

| legal_UK =

| legal_DE =

| C = 25 | H = 23 | F = 3 | N = 4 | O = 4

| IUPAC_name = 2-[6-(6,7-dimethoxyquinolin-3-yl)pyridin-3-yl]-N-[3-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-5-yl]acetamide

| CAS_number = 2216753-97-6

| CAS_number_Ref = {{Cascite|correct|UNII}}

| ChemSpiderID = 115007145

| PubChem = 134391533

| UNII = EP0P7SHM0U

| ChEMBL = 5095497

| smiles = CC(C)(C1=NOC(=C1)NC(=O)CC2=CN=C(C=C2)C3=CN=C4C=C(C(=CC4=C3)OC)OC)C(F)(F)F

| StdInChI = 1S/C25H23F3N4O4/c1-24(2,25(26,27)28)21-11-23(36-32-21)31-22(33)7-14-5-6-17(29-12-14)16-8-15-9-19(34-3)20(35-4)10-18(15)30-13-16/h5-6,8-13H,7H2,1-4H3,(H,31,33)

| StdInChIKey = KOLQINCWMXQEOF-UHFFFAOYSA-N

}}

Zeteletinib (BOS-172738, DS-5010) is an experimental anticancer medication which acts as a RET inhibitor.{{cite journal | vauthors = Vodopivec DM, Hu MI | title = RET kinase inhibitors for RET-altered thyroid cancers | journal = Therapeutic Advances in Medical Oncology | volume = 14 | issue = | pages = 17588359221101691 | date = 2022 | pmid = 35756966 | pmc = 9218446 | doi = 10.1177/17588359221101691 }}{{cite journal | vauthors = Gou Q, Gan X, Li L, Gou Q, Zhang T | title = Precious Gene: The Application of RET-Altered Inhibitors | journal = Molecules (Basel, Switzerland) | volume = 27 | issue = 24 | date = December 2022 | page = 8839 | pmid = 36557971 | pmc = 9784389 | doi = 10.3390/molecules27248839 | doi-access = free }}

See also

References